CAS 4791-21-3
:N-(Aminocarbonyl)-2-chloroacetamide
Description:
N-(Aminocarbonyl)-2-chloroacetamide, with the CAS number 4791-21-3, is a chemical compound characterized by its amide functional group and a chloro substituent on the acetamide structure. This compound typically appears as a white to off-white solid and is soluble in polar solvents due to the presence of the amide group, which can engage in hydrogen bonding. It has applications in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the chloro group can impart unique reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and storage, as with many chemical substances, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, N-(Aminocarbonyl)-2-chloroacetamide is a versatile compound with significant relevance in synthetic chemistry.
Formula:C3H5ClN2O2
InChI:InChI=1S/C3H5ClN2O2/c4-1-2(7)6-3(5)8/h1H2,(H3,5,6,7,8)
InChI key:InChIKey=UIXTUDLFNOIGRA-UHFFFAOYSA-N
SMILES:C(NC(N)=O)(CCl)=O
Synonyms:- (2-Chloro-acetyl)-urea
- (2-Chloroacetyl)urea
- Chloroacetylurea
- N-(Aminocarbonyl)-2-chloroacetamide
- N-(Chloroacetyl)urea
- NSC 32857
- Urea, (chloroacetyl)-
- acetamide, N-(aminocarbonyl)-2-chloro-
- N-Carbamoyl-2-chloroacetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2-Chloro-acetyl)-urea
CAS:<p>2-Chloro-acetyl)-urea is a disinfectant that has been shown to be active against bacterial spores. It reacts with sodium taurocholate to form mercuric chloride and triazine, which are the reaction products of the 2-chloro-acetyl)-urea. The molecular modeling study of 2-chloro-acetyl)-urea showed that this molecule has a hydrophobic region and can bind with water molecules through hydrogen bonding. This property allows it to act as a detergent composition in cleaning products. 2-Chloro-acetyl)-urea also has an ethyl diazoacetate group, which is used in biocides for its ability to penetrate cell membranes.<br>2-Chloro-acetyl)-urea is also used in molecular modeling studies as a substrate for s-adenosylhomocysteine hydrolase (SAHH) enzymes, which are involved in the synthesis of ad</p>Formula:C3H5ClN2O2Purity:Min. 95%Molecular weight:136.54 g/mol
