CAS 4792-71-6

5,7-dichloro-1H-indole-2-carboxylic acid

Description:

5,7-Dichloro-1H-indole-2-carboxylic acid is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of two chlorine atoms at the 5 and 7 positions of the indole ring contributes to its unique reactivity and properties. The carboxylic acid functional group at the 2-position enhances its acidity and solubility in polar solvents. This compound is typically used in chemical synthesis and research, particularly in the development of pharmaceuticals and agrochemicals. Its chlorinated structure may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound's molecular weight and specific physical properties, such as melting point and solubility, can vary based on environmental conditions and purity. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, 5,7-dichloro-1H-indole-2-carboxylic acid serves as a valuable building block in organic synthesis and a subject of study in various chemical applications.

Formula: C₉H₅Cl₂NO₂

InChI: InChI=1/C9H5Cl2NO2/c10-5-1-4-2-7(9(13)14)12-8(4)6(11)3-5/h1-3,12H,(H,13,14)

SMILES: c1c2cc(C(=O)O)[nH]c2c(cc1Cl)Cl

Synonyms:

• 1H-indole-2-carboxylic acid, 5,7-dichloro-

5,7-Dichloro-1H-indole-2-carboxylic acid

CAS: 4792-71-6

Formula: C₉H₅Cl₂NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 230.0475

Ref: IN-DA00D84T

5,7-Dichloro-1H-indole-2-carboxylic acid

CAS: 4792-71-6

5,7-Dichloro-1H-indole-2-carboxylic acid

Purity: 95%

Molecular weight: 230.05g/mol

Ref: 54-OR90511

5,7-Dichloro-indole-2-carboxylic acid

CAS: 4792-71-6

Formula: C₉H₅Cl₂NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 230.04

Ref: 10-F049478