CAS 479552-71-1

5-bromo-1-[(4-methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridine

Description:

5-bromo-1-[(4-methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridine is a chemical compound characterized by its complex structure, which includes a pyrrolopyridine core substituted with a bromine atom and a sulfonyl group attached to a para-methylphenyl moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The sulfonyl group enhances the compound's polarity and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the presence of the pyrrolopyridine framework suggests potential applications in drug development, particularly in targeting specific biological pathways. Its molecular structure may also confer unique electronic properties, which can be exploited in various chemical reactions or applications in materials science. Overall, this compound represents a class of heterocyclic compounds that are often studied for their pharmacological potential and synthetic utility.

Formula: C₁₄H₁₁BrN₂O₂S

InChI: InChI=1/C14H11BrN2O2S/c1-10-2-4-13(5-3-10)20(18,19)17-7-6-11-8-12(15)9-16-14(11)17/h2-9H,1H3

SMILES: Cc1ccc(cc1)S(=O)(=O)n1ccc2cc(cnc12)Br

Synonyms:

• 5-Brom-1-[(4-methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridin

1H-Pyrrolo[2,3-b]pyridine, 5-bromo-1-[(4-methylphenyl)sulfonyl]-

CAS: 479552-71-1

Formula: C₁₄H₁₁BrN₂O₂S

Purity: 95%

Molecular weight: 351.2183

Ref: IN-DA00DY5B

1H-PYRROLO[2,3-B]PYRIDINE, 5-BROMO-1-[(4-METHYLPHENYL)SULFONYL]-

CAS: 479552-71-1

Formula: C₁₄H₁₁BrN₂O₂S

Purity: 95.0%

Molecular weight: 351.22

Ref: 10-F469108