CAS 479669-74-4

(6aR,6bS,12bR)-5,6,6a,6b,7,12b-Hexahydro-3,9,12b-trihydroxybenzo[j]fluoranthene-4,8-dione

Description:

The chemical substance known as (6aR,6bS,12bR)-5,6,6a,6b,7,12b-Hexahydro-3,9,12b-trihydroxybenzo[j]fluoranthene-4,8-dione, with the CAS number 479669-74-4, is a polycyclic aromatic compound characterized by its complex fused ring structure. This compound features multiple hydroxyl groups, which contribute to its potential reactivity and solubility in various solvents. The presence of dione functional groups indicates that it can undergo various chemical transformations, including oxidation and reduction reactions. The stereochemistry, denoted by the specific R and S configurations, suggests that the compound may exhibit unique biological activity or interactions due to its three-dimensional shape. Such compounds are often studied for their potential applications in pharmaceuticals, materials science, and environmental chemistry. Additionally, the intricate structure may influence its physical properties, such as melting point, boiling point, and spectral characteristics, making it a subject of interest in both synthetic and analytical chemistry.

Formula: C₂₀H₁₆O₅

InChI: InChI=1S/C20H16O5/c21-13-3-1-2-10-18(13)16(24)8-12-9-4-6-14(22)19-15(23)7-5-11(17(9)19)20(10,12)25/h1-3,5,7,9,12,21,23,25H,4,6,8H2/t9-,12+,20+/m1/s1

InChI key: InChIKey=OYRYUFABCKQXTO-HGCCHXFOSA-N

SMILES: O[C@@]12C=3C=4[C@@]([C@@]1(CC(=O)C=5C2=CC=CC5O)[H])(CCC(=O)C4C(O)=CC3)[H]

Synonyms:

• Daldinone A
• Benzo[j]fluoranthene-4,8-dione, 5,6,6a,6b,7,12b-hexahydro-3,9,12b-trihydroxy-, (6aR,6bS,12bR)-
• (6aR,6bS,12bR)-5,6,6a,6b,7,12b-Hexahydro-3,9,12b-trihydroxybenzo[j]fluoranthene-4,8-dione

Daldinone A

CAS: 479669-74-4

Formula: C₂₀H₁₆O₅

Purity: 99.04%

Color and Shape: Brown. Amorphous solid

Molecular weight: 336.0

Ref: 8R-CL0064

Daldinone A

CAS: 479669-74-4

Daldinone A is a protein-based medicinal compound that acts as an inhibitor of kinases, which are enzymes involved in the regulation of cell growth and division. It has been shown to induce apoptosis, or programmed cell death, in human cancer cells. Daldinone A is a Chinese urine analog that has potent anticancer activity and may be useful in the treatment of various types of tumors. This compound works by binding to specific kinases and blocking their activity, which leads to reduced cell proliferation and increased apoptosis. As a result, Daldinone A has potential as a novel anticancer agent for the development of new cancer treatments.

Formula: C₂₀H₁₆O₅

Purity: Min. 95%

Molecular weight: 336.3 g/mol

Ref: 3D-EUA66974

Daldinone A

CAS: 479669-74-4

Daldinone A (Compound 4), isolated from Nigrospora oryzae, exhibits antibacterial properties, specifically demonstrating antimicrobial potential against P. aeruginosa [1].

Formula: C₂₀H₁₆O₅

Color and Shape: Solid

Molecular weight: 336.34

Ref: TM-T85038