CAS 4799-69-3
:4-(Phenylmethoxy)-2-butanol
Description:
4-(Phenylmethoxy)-2-butanol, with the CAS number 4799-69-3, is an organic compound characterized by its structure, which includes a butanol backbone substituted with a phenylmethoxy group. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate solubility in water, influenced by the presence of the hydroxyl (-OH) group. The phenylmethoxy moiety contributes to its hydrophobic characteristics, making it more soluble in organic solvents. It exhibits properties typical of alcohols, such as the ability to participate in hydrogen bonding, which can affect its boiling point and reactivity. Additionally, 4-(Phenylmethoxy)-2-butanol may have applications in organic synthesis and as an intermediate in the production of various chemical compounds. Its safety profile should be evaluated, as with any chemical substance, to ensure proper handling and usage in laboratory or industrial settings. Overall, this compound is of interest in both academic research and potential industrial applications due to its unique structural features.
Formula:C11H16O2
InChI:InChI=1S/C11H16O2/c1-10(12)7-8-13-9-11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3
InChI key:InChIKey=PPVYBGKNKMMISH-UHFFFAOYSA-N
SMILES:C(OCCC(C)O)C1=CC=CC=C1
Synonyms:- (±)-4-Benzyloxy-2-butanol
- 4-(Phenylmethoxy)-2-butanol
- 2-Butanol, 4-(phenylmethoxy)-
- 4-Benzyloxy-2-butanol
- 2-Butanol, 4-(benzyloxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-(Benzyloxy)butan-2-ol
CAS:<p>4-Benzyloxybutan-2-ol is an immobilization linker that is used to connect a molecule to a solid surface, such as glass. The carboxylate group of 4-benzyloxybutan-2-ol reacts with the hydroxyl groups on the glass surface and forms a covalent bond by reacting with the amine groups of the molecule. This linker can be used for immobilizing biomolecules or synthetic molecules in order to study their kinetics or other properties. It is also used for solid phase synthesis. 4-Benzyloxybutan-2-ol has been shown to be biocatalyzed by lipase and has been shown to have high reactivity at temperatures below 40°C. Techniques such as IR spectroscopy, NMR spectroscopy, and mass spectrometry are commonly used to characterize this compound.</p>Formula:C11H16O2Purity:Min. 95%Molecular weight:180.24 g/mol
