CAS 480-63-7: 2,4,6-Trimethylbenzoic acid
Description:2,4,6-Trimethylbenzoic acid, with the CAS number 480-63-7, is an aromatic carboxylic acid characterized by a benzene ring substituted with three methyl groups at the 2, 4, and 6 positions, along with a carboxylic acid functional group (-COOH) at the 1-position. This compound typically appears as a white crystalline solid and is known for its relatively high melting point. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water due to its hydrophobic methyl groups. 2,4,6-Trimethylbenzoic acid is utilized in various applications, including as an intermediate in organic synthesis and in the production of certain polymers and resins. Its structure contributes to its chemical reactivity, allowing it to participate in various reactions typical of carboxylic acids, such as esterification and acid-base reactions. Additionally, it may exhibit properties such as antimicrobial activity and can be used in the formulation of fragrances and flavorings.
Formula:C10H12O2
InChI:InChI=1S/C10H12O2/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5H,1-3H3,(H,11,12)
InChI key:InChIKey=FFFIRKXTFQCCKJ-UHFFFAOYSA-N
SMILES:O=C(O)C=1C(=CC(=CC1C)C)C
- Synonyms:
- 2,4,6-Trimethyl Benzoic Acid
- 2,4,6-Trimethylbenzoate
- Benzoic acid, 2,4,6-trimethyl-
- Mesitoic acid
- Mesitylene-2-carboxylic acid
- Mesitylenecarboxylic acid
- NSC 1119
- NSC 203160
- NSC 407983
- β-Isodurylic acid
- See more synonyms
- 2,4,6-Trimethylbenzoic acid
