CAS 480-67-1: 2,6-Dihydroxy-4-methylbenzoic acid
Description:2,6-Dihydroxy-4-methylbenzoic acid, also known as gentisic acid, is an aromatic compound characterized by the presence of two hydroxyl groups and a carboxylic acid group attached to a benzene ring. Its molecular formula is C8H8O4, and it features a methyl group at the para position relative to the carboxylic acid. This compound is typically a white to pale yellow crystalline solid that is soluble in water and organic solvents, reflecting its polar functional groups. 2,6-Dihydroxy-4-methylbenzoic acid exhibits antioxidant properties and is of interest in various fields, including pharmaceuticals and biochemistry, due to its potential applications in the synthesis of dyes, as well as its role in metabolic pathways. The compound can undergo various chemical reactions, including esterification and oxidation, making it versatile in organic synthesis. Its CAS number, 480-67-1, is used for identification in chemical databases and regulatory contexts.
Formula:C8H8O4
InChI:InChI=1S/C8H8O4/c1-4-2-5(9)7(8(11)12)6(10)3-4/h2-3,9-10H,1H3,(H,11,12)
InChI key:InChIKey=YBZAVRDNSPUMFK-UHFFFAOYSA-N
SMILES:O=C(O)C1=C(O)C=C(C=C1O)C
- Synonyms:
- 2,6-Dihydroxy-4-Methylbenzoate
- 2,6-Dihydroxy-4-Methylbenzoic Acid Hydrate
- 2,6-Dihydroxy-4-methylbenzoic acid
- 4-Methyl-γ-resorcylic acid
- Benzoic acid, 2,6-dihydroxy-4-methyl-
- p-Orsellinic acid
- γ-Resorcylic acid, 4-methyl-
