CAS 480425-36-3

N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide

Description:

N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide is an organic compound characterized by its unique structure, which includes a formamide functional group and a boron-containing moiety. The presence of the dioxaborolane ring contributes to its potential reactivity and stability, making it of interest in various chemical applications, particularly in organic synthesis and medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents, and its boron atom can participate in coordination chemistry, potentially enhancing its reactivity. The tetramethyl groups provide steric hindrance, which can influence the compound's interactions with other molecules. Additionally, the phenyl group contributes to the overall hydrophobic character of the molecule. Its specific applications may include use as a building block in the synthesis of more complex organic molecules or as a reagent in cross-coupling reactions. As with many boron-containing compounds, it may also exhibit unique optical or electronic properties, making it valuable in materials science and nanotechnology.

Formula: C₁₃H₁₈BNO₃

InChI: InChI=1/C13H18BNO3/c1-12(2)13(3,4)18-14(17-12)10-7-5-6-8-11(10)15-9-16/h5-9H,1-4H3,(H,15,16)

SMILES: CC1(C)C(C)(C)OB(c2ccccc2N=CO)O1

N-(2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)formamide

CAS: 480425-36-3

Formula: C₁₃H₁₈BNO₃

Molecular weight: 247.0979

Ref: IN-DA00D9RF

N[2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide

CAS: 480425-36-3

Formula: C₁₃H₁₈BNO₃

Molecular weight: 247.1

Ref: 10-F010841