CAS 480432-16-4

4-Hydroxy-3-[3-[(1-methylethyl)amino]-1-phenylpropyl]benzenemethanol

Description:

4-Hydroxy-3-[3-[(1-methylethyl)amino]-1-phenylpropyl]benzenemethanol, with the CAS number 480432-16-4, is a chemical compound that belongs to the class of phenolic compounds. It features a hydroxyl group (-OH) attached to a benzene ring, which contributes to its potential antioxidant properties. The compound also contains an isopropylamino group, which may influence its biological activity and solubility. Its structure suggests that it could interact with various biological targets, making it of interest in medicinal chemistry and pharmacology. The presence of multiple functional groups indicates that it may participate in hydrogen bonding and other intermolecular interactions, affecting its physical properties such as melting point, boiling point, and solubility in different solvents. Additionally, the compound's complex structure may lead to diverse applications in drug development, particularly in areas related to neuropharmacology or as a potential therapeutic agent. However, specific data regarding its reactivity, stability, and biological effects would require further investigation and empirical studies.

Formula: C₁₉H₂₅NO₂

InChI: InChI=1S/C19H25NO2/c1-14(2)20-11-10-17(16-6-4-3-5-7-16)18-12-15(13-21)8-9-19(18)22/h3-9,12,14,17,20-22H,10-11,13H2,1-2H3

InChI key: InChIKey=CCZYBOXFQXWQIF-UHFFFAOYSA-N

SMILES: C(CCNC(C)C)(C1=CC(CO)=CC=C1O)C2=CC=CC=C2

Synonyms:

• 4-Hydroxy-3-[3-[(1-methylethyl)amino]-1-phenylpropyl]benzenemethanol
• Benzenemethanol, 4-hydroxy-3-[3-[(1-methylethyl)amino]-1-phenylpropyl]-

Fesoterodine Impurity 15

CAS: 480432-16-4

Formula: C₁₉H₂₅NO₂

Molecular weight: 299.41

Ref: 4Z-F-3421

rac 5-Hydroxymethyl Desisopropyl Tolterodine

Controlled Product

CAS: 480432-16-4

Formula: C₁₉H₂₅NO₂

Color and Shape: Neat

Molecular weight: 299.407

Ref: TR-H950655