CAS 480438-58-2
:2-Ethoxy-4-fluorophenylboronic acid
Description:
2-Ethoxy-4-fluorophenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that also contains an ethoxy group and a fluorine atom. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the ethoxy group enhances its solubility and reactivity, while the fluorine atom can influence the electronic properties of the molecule, potentially affecting its biological activity. 2-Ethoxy-4-fluorophenylboronic acid is often utilized in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is a key method for forming carbon-carbon bonds in the synthesis of complex organic molecules. As with many boronic acids, it is important to handle this compound with care, as it may exhibit sensitivity to moisture and air.
Formula:C8H10BFO3
InChI:InChI=1/C8H10BFO3/c1-2-13-8-5-6(10)3-4-7(8)9(11)12/h3-5,11-12H,2H2,1H3
SMILES:CCOc1cc(ccc1B(O)O)F
Synonyms:- (2-Ethoxy-4-fluorophenyl)boronic acid
- boronic acid, B-(2-ethoxy-4-fluorophenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Ethoxy-4-fluorophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H10BFO3Purity:96.0 to 110.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:183.972-Ethoxy-4-fluorophenylboronic acid
CAS:Formula:C8H10BFO3Purity:96%Color and Shape:SolidMolecular weight:183.97262-Ethoxy-4-fluorophenylboronic acid
CAS:Formula:C8H10BFO3Purity:≥ 98.0%Color and Shape:Off-white powderMolecular weight:183.972-Ethoxy-4-fluorophenylboronic acid
CAS:2-Ethoxy-4-fluorophenylboronic acidPurity:96%Molecular weight:183.97g/mol2-Ethoxy-4-fluorophenylboronic acid
CAS:Formula:C8H10BFO3Purity:95%Color and Shape:SolidMolecular weight:183.97




