CAS 480438-83-3
:Tetrahydro-α-(trifluoromethyl)-2-thiophenepropanoic acid
Description:
Tetrahydro-α-(trifluoromethyl)-2-thiophenepropanoic acid is a chemical compound characterized by its unique structure, which includes a thiophene ring and a trifluoromethyl group. This compound typically exhibits properties associated with both its thiophene moiety and the presence of the trifluoromethyl group, which can enhance its lipophilicity and influence its reactivity. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit moderate solubility in polar solvents. Additionally, the trifluoromethyl group is known to impart distinctive electronic properties, potentially affecting the compound's biological activity and interactions with other molecules. This compound may be of interest in pharmaceutical research and development due to its potential applications in drug design, particularly in the development of compounds with specific biological activities. As with many chemical substances, safety data and handling precautions should be considered, especially given the presence of fluorinated groups, which can pose environmental and health risks.
Formula:C8H11F3O2S
InChI:InChI=1S/C8H11F3O2S/c9-8(10,11)6(7(12)13)4-5-2-1-3-14-5/h5-6H,1-4H2,(H,12,13)
InChI key:InChIKey=WZMDICHYPNRSDP-UHFFFAOYSA-N
SMILES:C(CC1CCCS1)(C(F)(F)F)C(O)=O
Synonyms:- 3,3,3-Trifluoro-2-[(tetrahydrothiophen-2-yl)methyl]propionic acid
- Tetrahydro-α-(trifluoromethyl)-2-thiophenepropanoic acid
- 3,3,3-Trifluoro-2-[(thiolan-2-yl)methyl]propanoic acid
- 2-Thiophenepropanoic acid, tetrahydro-α-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3,3,3-Trifluoro-2-((tetrahydrothiophen-2-yl)methyl)propanoic acid
CAS:Formula:C8H11F3O2SMolecular weight:228.23193,3,3-Trifluoro-2-(tetrahydrothien-2-ylmethyl)propanoic acid
CAS:3,3,3-Trifluoro-2-(tetrahydrothien-2-ylmethyl)propanoic acid
Molecular weight:228.23g/mol

