CAS 4805-17-8

2-(phenylethynyl)thiophene

Description:

2-(Phenylethynyl)thiophene is an organic compound characterized by its unique structure, which features a thiophene ring substituted with a phenylethynyl group. This compound typically exhibits a yellow to brown color and is known for its potential applications in organic electronics, particularly in organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs). The presence of the thiophene moiety contributes to its electronic properties, allowing for effective charge transport. Additionally, the phenylethynyl group enhances its stability and solubility in organic solvents. 2-(Phenylethynyl)thiophene is also noted for its ability to undergo various chemical reactions, making it a versatile building block in synthetic organic chemistry. Its photophysical properties, including absorption and emission spectra, are influenced by the conjugated system, which can be tuned for specific applications. Overall, this compound is of interest in materials science and organic synthesis due to its distinctive characteristics and functional potential.

Formula: C₁₂H₈S

InChI: InChI=1/C12H8S/c1-2-5-11(6-3-1)8-9-12-7-4-10-13-12/h1-7,10H

SMILES: c1ccc(cc1)C#Cc1cccs1

Synonyms:

• Thiophene, 2-(2-Phenylethynyl)-
• Thiophene, 2-(phenylethynyl)-

2-Phenylethynyl-thiophene

CAS: 4805-17-8

Formula: C₁₂H₈S

Purity: 98%

Color and Shape: Solid

Molecular weight: 184.2569

Ref: IN-DA01K5KI

2-(Phenylethynyl)thiophene

CAS: 4805-17-8

2-(Phenylethynyl)thiophene

Purity: 98%

Molecular weight: 184.26g/mol

Ref: 54-OR315660

2-(Phenylethynyl)thiophene

CAS: 4805-17-8

Formula: C₁₂H₈S

Purity: >95.0%(GC)

Color and Shape: White to Brown powder to crystal

Molecular weight: 184.26

Ref: 3B-P3136

2-(Phenylethynyl)thiophene

CAS: 4805-17-8

Purity: 98%

Molecular weight: 184.2599945

Ref: 10-F751003