CAS 48059-97-8

(E)-Oct-4-ene-1,8-dioic acid

Description:

(E)-Oct-4-ene-1,8-dioic acid, with the CAS number 48059-97-8, is an unsaturated dicarboxylic acid characterized by the presence of two carboxylic acid functional groups (-COOH) and a double bond in its carbon chain. The "(E)" configuration indicates that the substituents on the double bond are on opposite sides, which can influence its reactivity and physical properties. This compound typically exhibits a relatively high boiling point and melting point compared to saturated analogs due to the presence of the carboxylic acid groups, which can engage in hydrogen bonding. Its unsaturation allows for potential polymerization or further chemical modifications, making it of interest in organic synthesis and materials science. Additionally, the presence of the dicarboxylic acid functionality suggests potential applications in the production of biodegradable polymers, surfactants, or as intermediates in the synthesis of various organic compounds. As with many organic acids, it is likely to be soluble in polar solvents, such as water and alcohols, while exhibiting limited solubility in non-polar solvents.

Formula: C₈H₁₂O₄

InChI: InChI=1/C8H12O4/c9-7(10)5-3-1-2-4-6-8(11)12/h1-2H,3-6H2,(H,9,10)(H,11,12)/b2-1+

Synonyms:

• (4E)-Oct-4-enedioic acid
• 4-octenedioic acid, (4E)-
• Oct-4-enedioic acid
• (Z)-4-Octene-1,8-dioic acid

4-Octenedioic acid,(4E)-

CAS: 48059-97-8

Formula: C₈H₁₂O₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 172.1785

Ref: IN-DA003765

(4E)-4-Octenedioic acid

CAS: 48059-97-8

(4E)-4-Octenedioic acid

Purity: 96%

Molecular weight: 172.18g/mol

Ref: 54-OR96225

(4E)-4-Octenedioic acid

CAS: 48059-97-8

Purity: 96%

Molecular weight: 172.1799927

Ref: 10-F636383

E-Oct-4-ene-1,8-dioic acid

CAS: 48059-97-8

E-Oct-4-ene-1,8-dioic acid is an organic compound that belongs to the group of metathesis reactions. It is a skeleton for many macrocycles and stereoselectivity can be achieved through this reaction. The carbon skeleton can be used as a strategy to create new compounds with yields up to 99%. E-Oct-4-ene-1,8-dioic acid has been shown to have high yields in the synthesis of alkene compounds.

Formula: C₈H₁₂O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 172.18 g/mol

Ref: 3D-FO07064

(E)-Oct-4-ene-1,8-dioic Acid

Controlled Product

CAS: 48059-97-8

Formula: C₈H₁₂O₄

Color and Shape: Neat

Molecular weight: 172.179

Ref: TR-O239103