CymitQuimica logo

CAS 480994-56-7

:

Benzeneacetic acid, a-(4-formylphenoxy)-

Description:
Benzeneacetic acid, a-(4-formylphenoxy)-, is an organic compound characterized by its aromatic structure and functional groups. It features a benzene ring attached to an acetic acid moiety and a 4-formylphenoxy group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the formyl group indicates that it can participate in various chemical reactions, such as condensation and reduction. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic components, while the carboxylic acid group may impart some polar characteristics. Its molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as an intermediate in the synthesis of more complex molecules. Additionally, the compound's properties, such as melting point, boiling point, and reactivity, would be influenced by the specific arrangement of its atoms and the presence of functional groups. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C15H12O4
InChI:InChI=1S/C15H12O4/c16-10-11-6-8-13(9-7-11)19-14(15(17)18)12-4-2-1-3-5-12/h1-10,14H,(H,17,18)
InChI key:KFWOTZCJKPDGPJ-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C(C(=O)O)OC2=CC=C(C=C2)C=O
Found 4 products.