CAS 480996-05-2
:(4'-bromobiphenyl-4-yl)boronic acid
Description:
(4'-Bromobiphenyl-4-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a biphenyl structure. This compound features a bromine atom at the para position of one of the phenyl rings, which can influence its reactivity and solubility. Boronic acids are known for their ability to form reversible complexes with diols, making them valuable in organic synthesis, particularly in Suzuki coupling reactions for the formation of carbon-carbon bonds. The presence of the bromine substituent can enhance the electrophilicity of the compound, facilitating its use in various chemical transformations. Additionally, (4'-bromobiphenyl-4-yl)boronic acid may exhibit interesting electronic properties due to the conjugated biphenyl system, which can affect its optical characteristics. This compound is typically utilized in research and development within the fields of organic chemistry and materials science, particularly in the synthesis of complex organic molecules and polymers. Its stability and reactivity make it a useful building block in various synthetic applications.
Formula:C12H10BBrO2
InChI:InChI=1/C12H10BBrO2/c14-12-7-3-10(4-8-12)9-1-5-11(6-2-9)13(15)16/h1-8,15-16H
SMILES:c1cc(ccc1c1ccc(cc1)Br)B(O)O
Synonyms:- boronic acid, B-(4'-bromo[1,1'-biphenyl]-4-yl)-
- 4'-Bromo-4-biphenylboronic Acid
- 4-(4-Bromophenyl)benzeneboronic Acid
- amounts of Anhydride)
- 4'-BroMo-4-biphenylboronic Acid 
- Boronic acid, (4-bromo[1,1-biphenyl]-4-yl)- (9CI)
- 4-(4-Bromophenyl)benzeneboronic acid, 4-Borono-4'-bromobiphenyl
- 4'-Bromo-4-biphenylboronic Acid (contains varying amounts of Anhydride)
- 4'-Bromo-4-Benzoborate
- 4-Bromobiphenylboronic acid
- boronic Acid (contains varying
- 4-Bromobiphenyl-4&apos
- boronic Acid (contains varying amounts of Anhydride)
- 4-Bromobiphenyl-4'-boronic acid
- (4'-Bromo-biphenyl-4-yl)boronic acid
- 4'-Bromo-4-biphenyL
- 4'-Bromo-[1,1'-biphenyl]-4-boronic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4'-Bromo-4-biphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C12H10BBrO2Purity:97.0 to 107.0 %Color and Shape:White to Orange to Green powder to crystalMolecular weight:276.924'-Bromo-4-biphenylboronic acid
CAS:Formula:C12H10BBrO2Purity:98%Color and Shape:SolidMolecular weight:276.92164'-Bromo-[1,1'-biphenyl]-4-boronic acid
CAS:4'-Bromo-[1,1'-biphenyl]-4-boronic acidPurity:98%Molecular weight:276.92g/mol4′-Bromo-4-biphenylboronic acid
CAS:Formula:C12H10BBrO2Purity:98%Color and Shape:SolidMolecular weight:276.92



