CAS 481-18-5: α-Spinasterol
Description:α-Spinasterol is a sterol, a type of organic compound characterized by a complex structure that includes multiple interconnected carbon rings. It is primarily found in various plant sources, particularly in certain types of algae and higher plants. This compound is known for its role in the biosynthesis of other sterols and its potential health benefits, including anti-inflammatory and cholesterol-lowering properties. α-Spinasterol has a molecular formula that reflects its steroidal structure, and it typically exhibits a solid state at room temperature. Its solubility is generally low in water but higher in organic solvents, which is characteristic of many sterols. The compound can be analyzed using techniques such as nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry to determine its structure and purity. Additionally, α-Spinasterol may have applications in pharmaceuticals and nutraceuticals due to its biological activity, making it a subject of interest in both research and industry.
Formula:C29H48O
InChI:InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-9,11,19-23,25-27,30H,7,10,12-18H2,1-6H3/b9-8+/t20-,21-,22+,23+,25-,26+,27+,28+,29-/m1/s1
InChI key:InChIKey=JZVFJDZBLUFKCA-FXIAWGAOSA-N
SMILES:OC1CCC2(C)C3C(=CCC2C1)C4CCC(C(C=CC(CC)C(C)C)C)C4(C)CC3
- Synonyms:
- (3beta,5alpha,22E,24S)-stigmasta-7,22-dien-3-ol
- (3β,5α,22E)-Stigmasta-7,22-dien-3-ol
- 5α-Stigmasta-7,22-dien-3β-ol
- 5α-Stigmasta-7,22-dien-3β-ol, (E)-
- A-Spinasterol
- Alpha-Spinasterol
- Bessisterol
- Hitodesterol
- Spinasterol
- Stigmasta-7,22-dien-3-ol, (3β,5α,22E)-
- See more synonyms
- Stigmasta-7,22-dien-3β-ol
- Δ<sup>7,22</sup>-Stigmastan-3β-ol
- α-Spinasterin
