CAS 481-25-4
:Lophenol
Description:
Lophenol, with the CAS number 481-25-4, is a chemical compound that belongs to the class of phenolic compounds. It is characterized by its structural features, which include a hydroxyl group (-OH) attached to an aromatic ring, contributing to its reactivity and potential applications in various fields. Lophenol is typically a white to pale yellow solid and is known for its role in organic synthesis and as an intermediate in the production of other chemical substances. Its properties include moderate solubility in organic solvents and limited solubility in water, which is common for many phenolic compounds. Lophenol exhibits antioxidant properties, making it of interest in the study of natural products and potential applications in pharmaceuticals and cosmetics. Additionally, it may have implications in materials science due to its ability to form polymers. As with many chemical substances, handling Lophenol requires appropriate safety measures to mitigate any potential health risks associated with exposure.
Formula:C28H48O
InChI:InChI=1S/C28H48O/c1-18(2)8-7-9-19(3)22-12-13-24-21-10-11-23-20(4)26(29)15-17-28(23,6)25(21)14-16-27(22,24)5/h10,18-20,22-26,29H,7-9,11-17H2,1-6H3/t19-,20+,22-,23+,24+,25+,26+,27-,28+/m1/s1
InChI key:InChIKey=LMYZQUNLYGJIHI-SPONXPENSA-N
SMILES:C[C@@]12[C@@]3(C([C@]4([C@](C)(CC3)[C@@]([C@@H](CCCC(C)C)C)(CC4)[H])[H])=CC[C@]1([C@H](C)[C@@H](O)CC2)[H])[H]
Synonyms:- (3β,4α,5α)-4-Methylcholest-7-en-3-ol
- 4alpha-Methyl-5alpha-cholesta-7-en-3beta-ol
- 4α-Methyl-5α-cholest-7-en-3β-ol
- 4α-Methyl-Δ<sup>7</sup>-cholestene-3β-ol
- 5α-Cholest-7-en-3β-ol, 4α-methyl-
- Cholest-7-en-3-ol, 4-methyl-, (3.beta.,4.alpha.,5.alpha.)-
- Cholest-7-en-3-ol, 4-methyl-, (3beta,4alpha,5alpha)-
- Cholest-7-en-3-ol, 4-methyl-, (3β,4α,5α)-
- Lophenol
- Methost-7-enol
- Methostenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
