CAS 481-70-9: 9,10-Dihydro-1,6,8-trihydroxy-3-methyl-9,10-dioxo-2-anthracenecarboxylic acid

Description:9,10-Dihydro-1,6,8-trihydroxy-3-methyl-9,10-dioxo-2-anthracenecarboxylic acid, with the CAS number 481-70-9, is a polycyclic aromatic compound characterized by its complex structure, which includes multiple hydroxyl groups and a carboxylic acid functional group. This compound is derived from anthracene, a three-ring aromatic hydrocarbon, and exhibits properties typical of anthraquinone derivatives. It is known for its potential applications in dye chemistry and as a precursor in organic synthesis. The presence of hydroxyl groups contributes to its solubility in polar solvents and enhances its reactivity, making it a candidate for various chemical transformations. Additionally, the dioxo functionality suggests potential for redox activity, which may be exploited in biological or environmental contexts. Its stability and reactivity can be influenced by the pH of the environment, and it may exhibit fluorescence properties, which are common in many anthracene derivatives. Overall, this compound's unique structural features make it of interest in both industrial and research applications.

Formula:C₁₆H₁₀O₇

InChI:InChI=1S/C16H10O7/c1-5-2-7-12(14(20)10(5)16(22)23)15(21)11-8(13(7)19)3-6(17)4-9(11)18/h2-4,17-18,20H,1H3,(H,22,23)

InChI key:InChIKey=UZOHDKGTYVTYDZ-UHFFFAOYSA-N

SMILES:O=C(O)C1=C(O)C=2C(=O)C=3C(O)=CC(O)=CC3C(=O)C2C=C1C