
CAS 481-96-9
:Estradiol 3-sulfate
Description:
Estradiol 3-sulfate is a sulfated derivative of estradiol, a potent estrogen steroid hormone. It is characterized by the presence of a sulfate group attached to the 3-position of the estradiol molecule, which alters its solubility and biological activity. This compound is typically found in biological fluids and tissues, where it plays a role in estrogen metabolism and regulation. Estradiol 3-sulfate is less biologically active than estradiol itself but can serve as a reservoir for the hormone, being converted back to estradiol in certain tissues. Its chemical formula includes carbon, hydrogen, oxygen, and sulfur, reflecting its steroidal structure and the addition of the sulfate group. The substance is often studied in the context of hormonal therapies, reproductive health, and endocrine function. Additionally, it can be analyzed using various techniques such as chromatography and mass spectrometry for research and clinical purposes. Understanding its characteristics is essential for exploring its role in human physiology and potential therapeutic applications.
Formula:C18H24O5S
InChI:InChI=1S/C18H24O5S/c1-18-9-8-14-13-5-3-12(23-24(20,21)22)10-11(13)2-4-15(14)16(18)6-7-17(18)19/h3,5,10,14-17,19H,2,4,6-9H2,1H3,(H,20,21,22)/t14-,15-,16+,17+,18+/m1/s1
InChI key:InChIKey=QZIGLSSUDXBTLJ-ZBRFXRBCSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@](C=4C(CC3)=CC(OS(=O)(=O)O)=CC4)(CC1)[H])[H])(CC[C@@H]2O)[H]
Synonyms:- Estra-1,3,5(10)-triene-3,17-diol (17β)-, 3-(hydrogen sulfate)
- 17β-Estradiol sulfate
- Estradiol, 3-(hydrogen sulfate)
- 17β-Estradiol 3-sulfate
- Estradiol 3-sulfate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
