CAS 481075-49-4

2-Fluoro-3-(2-hydroxyethyl)benzoic acid

Description:

2-Fluoro-3-(2-hydroxyethyl)benzoic acid is an aromatic carboxylic acid characterized by the presence of a fluorine atom and a hydroxyethyl substituent on the benzene ring. The molecular structure features a benzoic acid core, which contributes to its acidic properties due to the carboxylic acid functional group (-COOH). The fluorine atom, located at the 2-position, can influence the compound's reactivity and polarity, potentially enhancing its biological activity or solubility in certain solvents. The hydroxyethyl group at the 3-position introduces a hydrophilic character, which may affect the compound's interactions with biological systems and its overall pharmacokinetics. This compound may exhibit various applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the presence of functional groups. As with many fluorinated compounds, it may also exhibit unique characteristics in terms of stability and reactivity, making it of interest in both research and industrial applications.

Formula: C₉H₉FO₃

InChI: InChI=1S/C9H9FO3/c10-8-6(4-5-11)2-1-3-7(8)9(12)13/h1-3,11H,4-5H2,(H,12,13)

InChI key: InChIKey=PKVHFXNIDRAJGE-UHFFFAOYSA-N

SMILES: C(CO)C1=C(F)C(C(O)=O)=CC=C1

Synonyms:

• Benzoic acid, 2-fluoro-3-(2-hydroxyethyl)-
• 2-Fluoro-3-(2-hydroxyethyl)benzoic acid