CAS 48122-14-1
:Hexahydro-3a-methyl-1,3-isobenzofurandione
Description:
Hexahydro-3a-methyl-1,3-isobenzofurandione, also known by its CAS number 48122-14-1, is a chemical compound characterized by its bicyclic structure, which includes a fused isobenzofuran and dione moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its potential applications in various fields, including organic synthesis and as a building block in the production of more complex molecules. The presence of the dione functional groups contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic additions and cycloadditions. Additionally, its unique structure may impart specific properties, such as solubility in organic solvents and potential interactions with biological systems. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, Hexahydro-3a-methyl-1,3-isobenzofurandione represents an interesting compound for further study in both synthetic and applied chemistry contexts.
Formula:C9H12O3
InChI:InChI=1S/C9H12O3/c1-9-5-3-2-4-6(9)7(10)12-8(9)11/h6H,2-5H2,1H3
InChI key:InChIKey=VYKXQOYUCMREIS-UHFFFAOYSA-N
SMILES:CC12C(C(=O)OC1=O)CCCC2
Synonyms:- 1,2-Cyclohexanedicarboxylic anhydride, 1-methyl-
- 1,3-Isobenzofurandione, hexahydro-3a-methyl-
- 1-Methylhexahydrophthalic anhydride
- Hexahydro-3a-methyl-1,3-isobenzofurandione
- Hexahydromethylphthalic anhydride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Hexahydro-3a-methyl-1,3-isobenzofurandione
CAS:Stability Moisture sensitive
Applications Hexahydro-4-methylphthalic Anhydride, can be used in the mixture of other isomers nanofiber supported 3D interconnected BN nanosheets for epoxy nanocomposites with ultrahigh thermal management capability
References Chen, J., et al.: Adv. Funct. Material., 27, 5 (2017)Formula:C9H12O3Color and Shape:NeatMolecular weight:168.18983a-Methyl-5,6,7,7a-Tetrahydro-4H-Isobenzofuran-1,3-Dione
CAS:Controlled Product3a-Methyl-5,6,7,7a-tetrahydro-4H-isobenzofuran-1,3-dione (MBF) is a reactive epoxy that can be used as a sealant. It has been shown to react with fatty acids and form epoxy esters. MBF also reacts with anhydrides to form polyesters. MBF has also been shown to be a potent inducer of cationic polymerization by reacting with hydroxyl groups on polymers. This reaction is reversible and the methylene groups are cleaved from the polymers to form new bonds with MBF. The resultant product is a cationic polymer that contains the hydroxyl group in place of the methylene group.Formula:C9H12O3Purity:Min. 95%Molecular weight:168.19 g/mol

