CAS 4813-02-9
:N'-methylidenepyridine-4-carbohydrazide
Description:
N'-Methylidenepyridine-4-carbohydrazide is an organic compound characterized by its hydrazone functional group, which is formed from the condensation of pyridine-4-carbohydrazide and formaldehyde or its derivatives. This compound typically appears as a crystalline solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. It exhibits properties such as moderate solubility in polar solvents, which can facilitate its use in chemical reactions and formulations. The presence of the pyridine ring contributes to its aromatic characteristics, influencing its reactivity and interaction with other chemical species. Additionally, the methylidene group enhances its electrophilic nature, making it a candidate for further chemical modifications. As with many hydrazones, it may also exhibit biological activity, which warrants investigation for potential therapeutic applications. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H7N3O
InChI:InChI=1/C7H7N3O/c1-8-10-7(11)6-2-4-9-5-3-6/h2-5H,1H2,(H,10,11)
Synonyms:- 4-Pyridinecarboxylicacid,methylenehydrazide(9CI)
- 4-Pyridinecarboxylic acid, 2-methylenehydrazide
- N-methyleneisonicotinohydrazide
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
