
CAS 4813-04-1
:4-Pyridinecarboxylic acid, 2-(1-methylethylidene)hydrazide
Description:
4-Pyridinecarboxylic acid, 2-(1-methylethylidene)hydrazide, also known by its CAS number 4813-04-1, is an organic compound characterized by its hydrazide functional group attached to a pyridine ring. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of both hydrophilic and hydrophobic regions in its molecular structure. The presence of the pyridine ring contributes to its aromatic character, which can influence its reactivity and interactions with other chemical species. Additionally, the hydrazide moiety may impart biological activity, making it of interest in pharmaceutical and agricultural applications. The compound may also participate in various chemical reactions, including condensation and substitution reactions, due to the functional groups present. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its practical applications. Overall, this compound represents a unique combination of structural features that can lead to diverse chemical behavior.
Formula:C9H11N3O
InChI:InChI=1S/C9H11N3O/c1-7(2)11-12-9(13)8-3-5-10-6-4-8/h3-6H,1-2H3,(H,12,13)
InChI key:InChIKey=LRCPYBHPYVZWBL-UHFFFAOYSA-N
SMILES:C(NN=C(C)C)(=O)C=1C=CN=CC1
Synonyms:- Acetone isonicotinyl-hydrazone
- 4-Pyridinecarboxylic acid, 2-(1-methylethylidene)hydrazide
- Acetone isonicotinoylhydrazone
- 4-Pyridinecarboxylic acid, (1-methylethylidene)hydrazide
- Isonicotinic acid, isopropylidenehydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

