CAS 48149-72-0: (2S,4S,5R)-2-allyloxy-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol
Description:The chemical substance known as (2S,4S,5R)-2-allyloxy-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol, with the CAS number 48149-72-0, is a carbohydrate derivative characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple hydroxyl (-OH) groups, contributing to its hydrophilicity and potential solubility in water. The presence of an allyloxy group indicates that it has a vinyl ether functionality, which can participate in various chemical reactions, including polymerization and cross-linking. The stereochemistry of the molecule, denoted by the (2S,4S,5R) configuration, suggests specific spatial arrangements of its substituents, which can influence its biological activity and reactivity. This compound may exhibit properties typical of sugar alcohols, such as sweetness and potential use as a sugar substitute. Additionally, its structural features may allow it to interact with biological systems, making it of interest in fields such as medicinal chemistry and biochemistry.
Formula:C9H16O6
InChI:InChI=1/C9H16O6/c1-2-3-14-9-8(13)7(12)6(11)5(4-10)15-9/h2,5-13H,1,3-4H2/t5?,6-,7-,8?,9-/m0/s1
