CAS 48149-72-0

(2S,4S,5R)-2-allyloxy-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol

Description:

The chemical substance known as (2S,4S,5R)-2-allyloxy-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol, with the CAS number 48149-72-0, is a carbohydrate derivative characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple hydroxyl (-OH) groups, contributing to its hydrophilicity and potential solubility in water. The presence of an allyloxy group indicates that it has a vinyl ether functionality, which can participate in various chemical reactions, including polymerization and cross-linking. The stereochemistry of the molecule, denoted by the (2S,4S,5R) configuration, suggests specific spatial arrangements of its substituents, which can influence its biological activity and reactivity. This compound may exhibit properties typical of sugar alcohols, such as sweetness and potential use as a sugar substitute. Additionally, its structural features may allow it to interact with biological systems, making it of interest in fields such as medicinal chemistry and biochemistry.

Formula: C₉H₁₆O₆

InChI: InChI=1/C9H16O6/c1-2-3-14-9-8(13)7(12)6(11)5(4-10)15-9/h2,5-13H,1,3-4H2/t5?,6-,7-,8?,9-/m0/s1

SMILES: C=CCO[C@@H]1C([C@H]([C@H](C(CO)O1)O)O)O

Allyl α-D-Galactopyranoside

CAS: 48149-72-0

Formula: C₉H₁₆O₆

Purity: 96%

Color and Shape: Solid

Molecular weight: 220.2197

Ref: IN-DA00DDXJ

Allyl a-D-galactopyranoside

CAS: 48149-72-0

Molecular weight: 220.22

Ref: 7W-GC4265

Allyl α-D-galactopyranoside

CAS: 48149-72-0

Allyl α-D-galactopyranoside

Purity: 98%

Molecular weight: 220.22g/mol

Ref: 54-OR5475T

Allyl α-D-galactopyranoside

CAS: 48149-72-0

Allyl α-D-galactopyranoside is a colorimetric reagent that reacts with the polysaccharides to form a colored product. The reaction is based on the transfer of an allyl group from the reagent to the polysaccharide. This reaction can be performed using atomic force microscopy and microscopy techniques, as well as using light and UV-visible spectroscopy. The reaction can also be used to measure glycopolymer concentrations. A titration procedure has been developed for this purpose, in which an excess of allyl α-D-galactopyranoside is added to a solution containing galactose and ammonium sulfate. Allyl α-D-galactopyranoside reacts with galactose to produce an insoluble precipitate that can be measured by weighing or using optical density measurements at a certain wavelength.

Formula: C₉H₁₆O₆

Purity: Min. 97 Area-%

Color and Shape: White Off-White Powder

Molecular weight: 220.22 g/mol

Ref: 3D-MA04469

Allyl α-D-galactopyranoside

CAS: 48149-72-0

Formula: C₉H₁₆O₆

Purity: 98%

Molecular weight: 220.221

Ref: 10-F329790