CAS 4815-28-5
:2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Description:
2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide, with the CAS number 4815-28-5, is a chemical compound characterized by its unique bicyclic structure that incorporates both a benzothiophene moiety and an amide functional group. This compound features a tetrahydrobenzothiophene ring, which contributes to its potential biological activity. The presence of the amino group enhances its solubility in polar solvents and may facilitate interactions with biological targets. The carboxamide group can participate in hydrogen bonding, influencing its reactivity and stability. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties, including anti-inflammatory and analgesic effects. Its structural features suggest that it may interact with various receptors or enzymes, making it a candidate for further research in drug development. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample.
Formula:C9H12N2OS
InChI:InChI=1/C9H12N2OS/c10-8(12)7-5-3-1-2-4-6(5)13-9(7)11/h1-4,11H2,(H2,10,12)
SMILES:C1CCc2c(C1)c(C(=O)N)c(N)s2
Synonyms:- 2-Amino-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxamide
- Benzo[b]thiophene-3-carboxamide, 2-amino-4,5,6,7-tetrahydro-
- 2-Amino-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Amino-4,5,6,7-Tetrahydro-1-Benzothiophene-3-Carboxamide
CAS:Formula:C9H12N2OSPurity:97%Color and Shape:SolidMolecular weight:196.26942-Amino-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxamide
CAS:2-Amino-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxamidePurity:98%Molecular weight:196.27g/mol2-Amino-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
CAS:2-Amino-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide is an anticancer agent that inhibits the synthesis of proteins required for cell division. It has been shown to have anticancer activity and efficacy in vitro studies against human cancer cells, such as HCT116. This compound also induces apoptosis in infected cells by binding to viral particles and inducing the release of chloride ions. 2-Amino-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide has been found to be effective against influenza virus and particle production by inhibiting neuraminidase activity.
Formula:C9H12SN2OPurity:Min. 95%Color and Shape:PowderMolecular weight:196.27 g/mol2-Amino-4,5,6,7-tetrahydro-benzo[ b ]thiophene-3-carboxylic acid amide
CAS:Formula:C9H12N2OSPurity:96%Color and Shape:SolidMolecular weight:196.27



