CAS 4815-43-4

Ethyl 2-amino-4,5-diphenyl-3-thiophenecarboxylate

Description:

Ethyl 2-amino-4,5-diphenyl-3-thiophenecarboxylate, with the CAS number 4815-43-4, is an organic compound characterized by its complex structure, which includes an ethyl ester group, an amino group, and a thiophene ring fused with phenyl groups. This compound typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry and organic synthesis. The presence of the amino group suggests it may exhibit basic properties, while the thiophene and phenyl groups contribute to its aromatic characteristics, potentially influencing its reactivity and solubility. Ethyl 2-amino-4,5-diphenyl-3-thiophenecarboxylate may also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in the synthesis of more complex molecules. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would depend on the conditions under which it is studied. Overall, this compound represents a versatile building block in organic chemistry.

Formula: C₁₉H₁₇NO₂S

InChI: InChI=1S/C19H17NO2S/c1-2-22-19(21)16-15(13-9-5-3-6-10-13)17(23-18(16)20)14-11-7-4-8-12-14/h3-12H,2,20H2,1H3

InChI key: InChIKey=KZDXAPZNXDJJMB-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C(=C(SC1N)C2=CC=CC=C2)C3=CC=CC=C3

Synonyms:

• Ethyl 2-amino-4,5-diphenyl-3-thiophenecarboxylate
• 3-Thiophenecarboxylic acid, 2-amino-4,5-diphenyl-, ethyl ester

Ethyl 2-amino-4,5-diphenylthiophene-3-carboxylate

CAS: 4815-43-4

Molecular weight: 323.4100036621094

Ref: 10-F097842