CAS 4816-82-4
:N-[(4-Methylphenyl)sulfonyl]-L-aspartic acid
Description:
N-[(4-Methylphenyl)sulfonyl]-L-aspartic acid, with the CAS number 4816-82-4, is an organic compound that features both amino acid and sulfonyl functional groups. This compound is characterized by its sulfonamide structure, which includes a sulfonyl group (-SO2-) attached to a phenyl ring that is further substituted with a methyl group at the para position. The presence of the L-aspartic acid moiety contributes to its biological relevance, as aspartic acid is a non-essential amino acid involved in various metabolic processes. The compound is typically a white to off-white solid and is soluble in polar solvents, which is common for amino acids and their derivatives. Its sulfonyl group enhances its potential for interactions in biological systems, making it of interest in medicinal chemistry and pharmacology. Additionally, the compound may exhibit specific biological activities, including potential roles in neurotransmission or as a building block in peptide synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C11H13NO6S
InChI:InChI=1S/C11H13NO6S/c1-7-2-4-8(5-3-7)19(17,18)12-9(11(15)16)6-10(13)14/h2-5,9,12H,6H2,1H3,(H,13,14)(H,15,16)/t9-/m0/s1
InChI key:InChIKey=SVCQSZKHLAERDL-VIFPVBQESA-N
SMILES:S(N[C@@H](CC(O)=O)C(O)=O)(=O)(=O)C1=CC=C(C)C=C1
Synonyms:- (2S)-2-(4-Methylbenzenesulfonamido)butanedioic acid
- <span class="text-smallcaps">L</span>-Aspartic acid, N-[(4-methylphenyl)sulfonyl]-
- Aspartic acid, N-(p-tolylsulfonyl)-
- Aspartic acid, N-(p-tolylsulfonyl)-, <span class="text-smallcaps">L</span>-
- N-Tosyl-<span class="text-smallcaps">L</span>-aspartic acid
- N-[(4-Methylphenyl)sulfonyl]-<span class="text-smallcaps">L</span>-aspartic acid
- N-[(4-methylphenyl)sulfonyl]-L-aspartic acid
- Aspartic acid, N-(p-tolylsulfonyl)-, L-
- N-Tosyl-L-aspartic acid
- L-Aspartic acid, N-[(4-methylphenyl)sulfonyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(S)-2-(4-Methylphenylsulfonamido)succinic acid
CAS:(S)-2-(4-Methylphenylsulfonamido)succinic acidPurity:95%Molecular weight:287.29g/molN-Tosyl-L-aspartic Acid
CAS:Controlled ProductApplications N-Tosyl-L-aspartic Acid is a protected L-Aspartic Acid, a nonessential amino acid.
References Singh, S. P., et al.: J. Org. Chem., 76, 6825 (2011)Formula:C11H13NO6SColor and Shape:NeatMolecular weight:287.29N-Tosyl-L-aspartic acid
CAS:N-Tosyl-L-aspartic acid is a chemical compound that is used as an intermediate in the manufacture of other compounds. It can be obtained by reacting tosyl chloride with L-aspartic acid. The azide group reacts readily with amines, alcohols, and carboxylic acids. This reaction forms the corresponding ester or amide of the carboxylic acid. N-Tosyl-L-aspartic acid has also been used in the synthesis of penicillins, cephalosporins, and thiocarbamates. N-Tosyl-L-aspartic acid is synthesised by refluxing a mixture of thionyl chloride and aspartic acid in dextrose solution containing amines such as triethylamine or pyridine.Formula:C11H13NO6SPurity:Min. 95%Molecular weight:287.29 g/mol




