CAS 481681-02-1
:[4-fluoro-3-(hydroxymethyl)phenyl]boronic acid
Description:
[4-Fluoro-3-(hydroxymethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a phenyl ring substituted with a fluorine atom and a hydroxymethyl group, contributing to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, making it valuable in the formation of carbon-carbon bonds. Additionally, the presence of the fluorine atom can enhance the compound's lipophilicity and influence its biological activity. The hydroxymethyl group may also serve as a site for further functionalization or modification. Overall, [4-fluoro-3-(hydroxymethyl)phenyl]boronic acid is a versatile building block in the development of pharmaceuticals and agrochemicals, with properties that facilitate its use in various chemical transformations.
Formula:C7H8BFO3
InChI:InChI=1/C7H8BFO3/c9-7-2-1-6(8(11)12)3-5(7)4-10/h1-3,10-12H,4H2
SMILES:c1cc(c(cc1B(O)O)CO)F
Synonyms:- boronic acid, B-[4-fluoro-3-(hydroxymethyl)phenyl]-
- 4-Fluoro-3-(Hydroxymethyl)Benzeneboronic Acid
- 4-Fluoro-3-hydroxyMethyl)phenylboronic acid
- [4-Fluoro-3-(hydroxymethyl)phenyl]boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Fluoro-3-(hydroxymethyl)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H8BFO3Purity:min. 97.0 area%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:169.954-Fluoro-3-(hydroxymethyl)benzeneboronic acid, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H8BFO3Purity:98%Molecular weight:169.954-Fluoro-3-(hydroxymethyl)benzeneboronic acid
CAS:Formula:C7H8BFO3Purity:98%Color and Shape:SolidMolecular weight:169.94604-Fluoro-3-(hydroxymethyl)benzeneboronic acid
CAS:<p>4-Fluoro-3-(hydroxymethyl)benzeneboronic acid</p>Formula:C7H8BFO3Purity:98%Color and Shape: whtie to off white. lumpy crystalline powderMolecular weight:169.94602g/mol[4-Fluoro-3-(hydroxymethyl)phenyl]boronic acid
CAS:Formula:C7H8BFO3Purity:98%Color and Shape:SolidMolecular weight:169.95




