CAS 4818-85-3

2-[(furan-2-ylmethyl)amino]-5-sulfamoylbenzoic acid

Description:

2-[(Furan-2-ylmethyl)amino]-5-sulfamoylbenzoic acid, with the CAS number 4818-85-3, is a chemical compound that exhibits both acidic and basic properties due to the presence of a carboxylic acid group and an amino group. This compound features a furan ring, which contributes to its aromatic character and potential reactivity, as well as a sulfonamide group that enhances its solubility in polar solvents. The presence of the sulfonamide moiety often imparts biological activity, making it of interest in medicinal chemistry. The compound is likely to be a solid at room temperature, with moderate stability under standard conditions. Its structure suggests potential interactions with biological targets, which may include enzyme inhibition or modulation of metabolic pathways. Additionally, the compound's functional groups may allow for hydrogen bonding and other intermolecular interactions, influencing its solubility and reactivity. Overall, 2-[(furan-2-ylmethyl)amino]-5-sulfamoylbenzoic acid is a versatile compound with potential applications in pharmaceuticals and research.

Formula: C₁₂H₁₂N₂O₅S

InChI: InChI=1/C12H12N2O5S/c13-20(17,18)9-3-4-11(10(6-9)12(15)16)14-7-8-2-1-5-19-8/h1-6,14H,7H2,(H,15,16)(H2,13,17,18)

SMILES: c1cc(CNc2ccc(cc2C(=O)O)S(=O)(=O)N)oc1

Furosemide Impurity 17

CAS: 4818-85-3

Formula: C₁₂H₁₂N₂O₅S

Molecular weight: 296.30

Ref: 4Z-F-2126

2-{[(Furan-2-yl)methyl]amino}-5-sulfamoylbenzoic acid

CAS: 4818-85-3

2-{[(Furan-2-yl)methyl]amino}-5-sulfamoylbenzoic acid is a water soluble drug that is used as a dietary supplement. It has been shown to be effective in inhibiting the growth of cancer cells and preventing the carcinogenic properties of some chemical compounds. 2-{[(Furan-2-yl)methyl]amino}-5-sulfamoylbenzoic acid has been shown to inhibit the growth of cancer cells, with no evidence of toxicity in rats. The compound was found to be safe for use in humans, but its carcinogenic activity could not be ruled out. Studies have shown that 2-[(furan-2-yl)methyl]amino]-5-(sulfamoyl)benzoic acid can inhibit the growth of cancer cells and prevent the carcinogenic properties of chemical compounds. 2-[(furan-2-yl)methyl]am

Formula: C₁₂H₁₂N₂O₅S

Purity: Min. 95%

Molecular weight: 296.3 g/mol

Ref: 3D-EAA81885

Furosemide Impurity 5

CAS: 4818-85-3

Formula: C₁₂H₁₂N₂O₅S

Molecular weight: 296.30

Ref: ST-EA-CP-F25012