CAS 4819-22-1
:N-Acetyl-L-isoleucine ethyl ester
Description:
N-Acetyl-L-isoleucine ethyl ester is an organic compound characterized by its structure, which includes an acetyl group and an ethyl ester linked to the amino acid isoleucine. This compound is typically a white to off-white solid or powder, and it is soluble in organic solvents such as ethanol and methanol, but may have limited solubility in water. It is often used in biochemical research and pharmaceutical applications due to its role as a building block in peptide synthesis and its potential biological activity. The presence of the acetyl group can enhance the compound's stability and bioavailability. As with many amino acid derivatives, it may exhibit specific optical activity, reflecting its chiral nature. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed. Overall, N-Acetyl-L-isoleucine ethyl ester serves as a valuable compound in various chemical and biological contexts.
Formula:C10H19NO3
InChI:InChI=1S/C10H19NO3/c1-5-7(3)9(11-8(4)12)10(13)14-6-2/h7,9H,5-6H2,1-4H3,(H,11,12)/t7-,9-/m0/s1
InChI key:InChIKey=FQTDATMBOBJGPQ-CBAPKCEASA-N
SMILES:[C@@H](C(OCC)=O)([C@H](CC)C)NC(C)=O
Synonyms:- N-Acetyl-L-isoleucine ethyl ester
- L-Isoleucine, N-acetyl-, ethyl ester
- Isoleucine, N-acetyl-, ethyl ester, L-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
