CAS 482-01-9

(±)-Homoferreirin

Description:

(±)-Homoferreirin, with the CAS number 482-01-9, is a chemical compound that belongs to the class of alkaloids, specifically derived from the plant species of the genus "Ferreirin." This compound is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. It typically exhibits a chiral nature, meaning it has two enantiomers that can have different effects in biological systems. (±)-Homoferreirin is known for its potential pharmacological properties, including antimicrobial and anti-inflammatory activities, making it of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in research and potential therapeutic uses. As with many alkaloids, safety and toxicity profiles are important considerations when handling this compound in laboratory settings. Further studies are often required to fully elucidate its mechanisms of action and potential applications in various fields, including pharmacology and natural product chemistry.

Formula: C₁₇H₁₆O₆

InChI: InChI=1S/C17H16O6/c1-21-10-3-4-11(14(7-10)22-2)12-8-23-15-6-9(18)5-13(19)16(15)17(12)20/h3-7,12,18-19H,8H2,1-2H3

InChI key: InChIKey=LMLDNMHDNFCNCW-UHFFFAOYSA-N

SMILES: O=C1C(COC=2C1=C(O)C=C(O)C2)C3=C(OC)C=C(OC)C=C3

Synonyms:

• 3-(2,4-Dimethoxyphenyl)-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one
• 4H-1-Benzopyran-4-one, 3-(2,4-dimethoxyphenyl)-2,3-dihydro-5,7-dihydroxy-
• Isoflavanone, 5,7-dihydroxy-2′,4′-dimethoxy-
• Homoferreirin
• (±)-Homoferreirin

Homoferreirin

CAS: 482-01-9

Formula: C₁₇H₁₆O₆

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 316.309

Ref: BP-SBP02567

Homoferreirin

CAS: 482-01-9

Homoferreirin is a biochemical siderophore, which is a low-molecular-weight iron-chelating compound derived from plant sources. Its mechanism of action involves binding ferric iron (Fe^3+) ions with high affinity, forming a stable complex. This complex aids in the solubilization and transport of iron across cellular membranes, which is crucial in environments where iron availability is limited, such as in soil and certain biological niches.

Formula: C₁₇H₁₆O₆

Purity: Min. 95%

Molecular weight: 316.31 g/mol

Ref: 3D-XH161798