CAS 482-05-3
:Diphenic acid
Description:
Diphenic acid, also known as 2,2'-diphenyl-1,1'-dicarboxylic acid, is an organic compound characterized by its two phenyl groups attached to a central dicarboxylic acid structure. It appears as a white crystalline solid and is sparingly soluble in water, but more soluble in organic solvents such as ethanol and acetone. The compound exhibits a melting point that is typically in the moderate range, indicative of its crystalline nature. Diphenic acid is known for its potential applications in the synthesis of various organic compounds, including dyes and pharmaceuticals, due to its ability to undergo various chemical reactions, such as esterification and amidation. Additionally, it can serve as a building block in polymer chemistry. The presence of two carboxylic acid functional groups allows for the formation of hydrogen bonds, influencing its physical properties and reactivity. Safety data indicates that, like many organic acids, it should be handled with care to avoid irritation to skin and eyes.
Formula:C14H10O4
InChI:InChI=1S/C14H10O4/c15-13(16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)18/h1-8H,(H,15,16)(H,17,18)
InChI key:InChIKey=GWZCCUDJHOGOSO-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC=C1)C2=C(C(O)=O)C=CC=C2
Synonyms:- 2,2-Biphenyldicarboxylic acid
- 2,2-Diphenit acid
- 2,2′-Bibenzoic acid
- 2,2′-Dicarboxybiphenyl
- 2,2′-Diphenic acid
- 2-(2-Carboxyphenyl)benzoic acid
- 2′-Carboxybiphenyl-2-carboxylic acid
- Biphenic Acid
- Biphenyl-2,2'-Dicarboxylate
- Biphenyl-2,2'-Dicarboxylic Acid
- Diphenyl-2,2′-dicarboxylic acid
- NSC 1966
- [1,1-Biphenyl]-2,2-dicarboxylic acid
- o,o′-Bibenzoic acid
- o,o′-Diphenic acid
- o-Phenyl Benzoic Acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
[1,1'-Biphenyl]-2,2'-dicarboxylic acid
CAS:Formula:C14H10O4Purity:97%Color and Shape:SolidMolecular weight:242.2268[1,1'-Biphenyl]-2,2'-dicarboxylic acid
CAS:[1,1'-Biphenyl]-2,2'-dicarboxylic acidPurity:98%Color and Shape:White To Off White PowderMolecular weight:242.2268g/mol2,2'-Biphenyldicarboxylic Acid
CAS:Formula:C14H10O4Purity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:242.232,2'-Biphenyldicarboxylic acid
CAS:2,2'-Biphenyldicarboxylic acid belongs to the group of diphenic compounds and is synthesized by the reaction of 2-bromobenzene and sodium carbonate. It has a molecular formula of C12H10O4 with an empirical formula of C8H6O4. The compound is an intramolecular hydrogen bond acceptor and an intermolecular hydrogen bond donor. 2,2'-Biphenyldicarboxylic acid has been shown to have analytical chemistry properties for measuring nitrogen content in organic compounds, as well as being used in the synthesis of p-hydroxybenzoic acid. This compound also has metabolic disorders such as cancer, diabetes mellitus, and Alzheimer's disease because it is a hydrogen bond acceptor that can be oxidized into p-hydroxybenzoic acid.Formula:C14H10O4Purity:Min. 95%Color and Shape:PowderMolecular weight:242.23 g/mol




