CAS 482-45-1
:Isoimperatorin
Description:
Isoimperatorin is a naturally occurring compound classified as a furanocoumarin, which is a type of organic compound known for its diverse biological activities. It is primarily found in various plants, particularly in the Apiaceae family, which includes herbs like parsley and celery. Isoimperatorin is characterized by its chemical structure, which features a furan ring fused to a coumarin moiety, contributing to its unique properties. This compound exhibits several pharmacological effects, including anti-inflammatory, antioxidant, and antimicrobial activities, making it of interest in medicinal chemistry and herbal medicine. Additionally, isoimperatorin has been studied for its potential role in modulating certain biological pathways, which may have implications for therapeutic applications. Its CAS number, 482-45-1, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases. As with many natural products, isoimperatorin's efficacy and safety profile are subjects of ongoing research, particularly in the context of traditional medicine and modern pharmacology.
Formula:C16H14O4
InChI:InChI=1S/C16H14O4/c1-10(2)5-7-19-16-11-3-4-15(17)20-14(11)9-13-12(16)6-8-18-13/h3-6,8-9H,7H2,1-2H3
InChI key:InChIKey=IGWDEVSBEKYORK-UHFFFAOYSA-N
SMILES:O(CC=C(C)C)C=1C2=C(C=C3C1C=CO3)OC(=O)C=C2
Synonyms:- 4-[(3-Methyl-2-buten-1-yl)oxy]-7H-furo[3,2-g][1]benzopyran-7-one
- 4-[(3-Methylbut-2-en-1-yl)oxy]-7H-furo[3,2-g]chromen-7-one
- 7H-Furo(3,2-g)(1)benzopyran-7-one, 4-((3-methyl-2-butenyl)oxy)-
- 7H-furo[3,2-g][1]benzopyran-7-one, 4-[(3-methyl-2-buten-1-yl)oxy]-
- Isoimperatorin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 15 products.
Isoimperatorin
CAS:Formula:C16H14O4Purity:>97.0%(HPLC)(qNMR)Color and Shape:White to Light yellow powder to crystalMolecular weight:270.28Isoimperatorin
CAS:Isoimperatorin is a medicinal herbal product that is isolated from the dried roots of Angelicae dahuricae ,can inhibit the cyclooxygenase-2 (COX-2) and COX-1-dependent phases of prostaglandin D 2 (PGD 2 ) generation in bone marrow-derived mast cells (BMMC) in a concentration-dependent manner, with IC 50 values of 10.7 μM and 24 μM, respectively; it may provide the basis for novel anti-inflammatory drugs.Formula:C16H14O4Purity:95%~99%Color and Shape:PowderMolecular weight:270.284Isoimperatorin
CAS:<p>Isoimperatorin is an anti-inflammatory agent, exhibits significant inhibitory effects on acetylcholinesterase (AChE).</p>Formula:C16H14O4Purity:98.26% - 99.93%Color and Shape:White PowderMolecular weight:270.28Isoimperatorin
CAS:LactoneFormula:C16H14O4Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:270.29Iso Imperatorin
CAS:Controlled Product<p>Applications Anti-inflammatory. Effect on proliferation.<br></p>Formula:C16H14O4Color and Shape:WhiteMolecular weight:270.28Isoimperatorin
CAS:<p>Isoimperatorin is a naturally occurring furanocoumarin, which is a phytochemical compound found in certain plants, particularly within the Apiaceae family, such as Angelica dahurica. It is extracted from these botanical sources through processes like solvent extraction. Isoimperatorin exhibits a diverse mode of action, including the inhibition of various enzymes and modulation of signaling pathways. It has demonstrated significant effects on cytochrome P450 enzymes, potentially influencing drug metabolism. Additionally, Isoimperatorin has shown antioxidant properties and the ability to interfere with cell proliferation and apoptosis mechanisms.</p>Formula:C16H14O4Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:270.29 g/mol
