CAS 482-76-8
:α-(3,4-Dimethoxyphenyl)-6,7-dimethoxy-1-isoquinolinemethanol
Description:
α-(3,4-Dimethoxyphenyl)-6,7-dimethoxy-1-isoquinolinemethanol, with the CAS number 482-76-8, is a chemical compound that belongs to the isoquinoline class of alkaloids. This substance is characterized by its complex molecular structure, which includes multiple methoxy groups that contribute to its unique chemical properties. The presence of these methoxy substituents typically enhances the compound's lipophilicity, potentially affecting its biological activity and solubility. Isoquinolines are known for their diverse pharmacological activities, including antitumor, antimicrobial, and neuroprotective effects. The specific arrangement of the methoxy groups in this compound may influence its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific optical properties due to its chiral centers, which can be relevant in the development of enantiomerically pure drugs. Overall, α-(3,4-Dimethoxyphenyl)-6,7-dimethoxy-1-isoquinolinemethanol represents a fascinating subject for further research in both synthetic and medicinal chemistry.
Formula:C20H21NO5
InChI:InChI=1S/C20H21NO5/c1-23-15-6-5-13(10-16(15)24-2)20(22)19-14-11-18(26-4)17(25-3)9-12(14)7-8-21-19/h5-11,20,22H,1-4H3
InChI key:InChIKey=JJZIJKXUHDFVGX-UHFFFAOYSA-N
SMILES:C(O)(C=1C2=C(C=C(OC)C(OC)=C2)C=CN1)C3=CC(OC)=C(OC)C=C3
Synonyms:- (6,7-Dimethoxy-isoquinolin-1-yl)-(3,4-dimethoxy-phenyl)-methanol
- (6,7-Dimethoxyisoquinolin-1-Yl)(3,4-Dimethoxyphenyl)Methanol
- 1-Isoquinolinemethanol, α-(3,4-dimethoxyphenyl)-6,7-dimethoxy-
- NSC 121864
- Papaverinol
- alpha-(3,4-Dimethoxyphenyl)-6,7-dimethoxyisoquinoline-1-methanol
- α-(3,4-Dimethoxyphenyl)-6,7-dimethoxy-1-isoquinolinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Papaverine EP Impurity B (Papaverinol)
CAS:Formula:C20H21NO5Color and Shape:Pale Yellow SolidMolecular weight:355.39Papaverinol
CAS:Controlled ProductApplications Papaverinol is a photooxidation product of Papaverine Hydrochloride (P190500) and can be used as a potential acetylcholinesterase inhibitor.
References Markmee, S., et al.: Bioorg. Med. Chem. Lett., 16, 2170 (2006); Valevko, S. A., et al.: Farmatsiya, 35, 38 (1986); Piotrowska K., et al.: Acta Pol. Pharm., 59, 359 (2002)Formula:C20H21NO5Color and Shape:NeatMolecular weight:355.38


