CAS 48208-26-0: (2S)-2-(1,3-dioxo-1,3,5,6-tetrahydro-2H-isoindol-2-yl)-3-(1H-indol-3-yl)propanoic acid
Description:The chemical substance known as (2S)-2-(1,3-dioxo-1,3,5,6-tetrahydro-2H-isoindol-2-yl)-3-(1H-indol-3-yl)propanoic acid, with the CAS number 48208-26-0, is a complex organic compound characterized by its unique structural features. It contains an isoindole moiety and an indole ring, which contribute to its potential biological activity. The presence of the dioxo group suggests that it may participate in various chemical reactions, possibly acting as a reactive intermediate or influencing its interaction with biological targets. The propanoic acid functional group indicates that it is likely to exhibit acidic properties, which may affect its solubility and reactivity in different environments. This compound may be of interest in medicinal chemistry due to its structural complexity and potential pharmacological applications. However, specific details regarding its physical properties, such as melting point, solubility, and spectral characteristics, would require further investigation through experimental methods or literature sources.
Formula:C19H16N2O4
InChI:InChI=1/C19H16N2O4/c22-17-13-6-1-2-7-14(13)18(23)21(17)16(19(24)25)9-11-10-20-15-8-4-3-5-12(11)15/h3-8,10,16,20H,1-2,9H2,(H,24,25)/t16-/m0/s1