CAS 48208-26-0

(2S)-2-(1,3-dioxo-1,3,5,6-tetrahydro-2H-isoindol-2-yl)-3-(1H-indol-3-yl)propanoic acid

Description:

The chemical substance known as (2S)-2-(1,3-dioxo-1,3,5,6-tetrahydro-2H-isoindol-2-yl)-3-(1H-indol-3-yl)propanoic acid, with the CAS number 48208-26-0, is a complex organic compound characterized by its unique structural features. It contains an isoindole moiety and an indole ring, which contribute to its potential biological activity. The presence of the dioxo group suggests that it may participate in various chemical reactions, possibly acting as a reactive intermediate or influencing its interaction with biological targets. The propanoic acid functional group indicates that it is likely to exhibit acidic properties, which may affect its solubility and reactivity in different environments. This compound may be of interest in medicinal chemistry due to its structural complexity and potential pharmacological applications. However, specific details regarding its physical properties, such as melting point, solubility, and spectral characteristics, would require further investigation through experimental methods or literature sources.

Formula: C₁₉H₁₆N₂O₄

InChI: InChI=1/C19H16N2O4/c22-17-13-6-1-2-7-14(13)18(23)21(17)16(19(24)25)9-11-10-20-15-8-4-3-5-12(11)15/h3-8,10,16,20H,1-2,9H2,(H,24,25)/t16-/m0/s1

SMILES: C1CC=C2C(=C1)C(=O)N([C@@H](Cc1c[nH]c3ccccc13)C(=O)O)C2=O

N-Phthalyl-L-tryptophan

CAS: 48208-26-0

Formula: C₁₉H₁₄N₂O₄

Purity: >98.0%(T)(HPLC)

Color and Shape: Light yellow to Amber to Dark green powder to crystaline

Molecular weight: 334.33

Ref: 3B-P2023

N-Phthalyl-L-tryptophan

CAS: 48208-26-0

Formula: C₁₉H₁₄N₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 334.3255

Ref: IN-DA003U4E

RG108

CAS: 48208-26-0

Formula: C₁₉H₁₄N₂O₄

Molecular weight: 334.32

Ref: 7W-GL6651

RG108

CAS: 48208-26-0

RG108

Purity: ≥98%

Molecular weight: 334.33g/mol

Ref: 54-BUP13446

RG108

CAS: 48208-26-0

RG108

Purity: >98%

Color and Shape: Solid

Molecular weight: 334.32546g/mol

Ref: 54-BIR1004

RG108

CAS: 48208-26-0

RG108 (N-Phthalyl-L-tryptophan) is an DNA methyltransferase inhibitor(IC50=115 nM).

Formula: C₁₉H₁₄N₂O₄

Purity: 98% - 99.43%

Color and Shape: Solid

Molecular weight: 334.33

Ref: TM-T2038

RG 108

CAS: 48208-26-0

Inhibitor of DNA methyltransferase 1

Formula: C₁₉H₁₄N₂O₄

Purity: Min. 95%

Molecular weight: 334.33 g/mol

Ref: 3D-FP31760