CAS 4821-00-5
:1-methyl-1H-indole-5,6-diol
Description:
1-Methyl-1H-indole-5,6-diol, with the CAS number 4821-00-5, is an organic compound that belongs to the indole family, characterized by a bicyclic structure containing a fused benzene and pyrrole ring. This compound features a methyl group at the nitrogen atom of the indole ring and hydroxyl groups at the 5 and 6 positions, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of hydroxyl groups, which can engage in hydrogen bonding. The presence of these functional groups also suggests potential biological activity, making it of interest in medicinal chemistry and pharmacology. Additionally, 1-methyl-1H-indole-5,6-diol may participate in various chemical reactions, including oxidation and substitution, which can lead to the formation of derivatives with altered properties. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications.
Formula:C9H9NO2
InChI:InChI=1/C9H9NO2/c1-10-3-2-6-4-8(11)9(12)5-7(6)10/h2-5,11-12H,1H3
SMILES:Cn1ccc2cc(c(cc12)O)O
Synonyms:- 1H-indole-5,6-diol, 1-methyl-
- 1-Methyl-5,6-dihydroxyindole
- 1-Methyl-1H-indole-5,6-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Epinephrine Impurity 8
CAS:Formula:C9H9NO2Color and Shape:Yellowish-Brown SolidMolecular weight:163.18
