CAS 4821-19-6

2,6-Dicyclohexylphenol

Description:

2,6-Dicyclohexylphenol is an organic compound characterized by its phenolic structure, where two cyclohexyl groups are substituted at the 2 and 6 positions of the phenol ring. This compound is typically a white to off-white solid at room temperature and is known for its relatively high melting point. It is soluble in organic solvents but has limited solubility in water, which is common for many phenolic compounds. 2,6-Dicyclohexylphenol exhibits antioxidant properties and is often utilized in various industrial applications, including as a stabilizer in plastics and as an intermediate in the synthesis of other chemical compounds. Its chemical stability and resistance to oxidation make it valuable in formulations requiring durability. Additionally, it may have applications in the production of lubricants and coatings. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during its use.

Formula: C₁₈H₂₆O

InChI: InChI=1S/C18H26O/c19-18-16(14-8-3-1-4-9-14)12-7-13-17(18)15-10-5-2-6-11-15/h7,12-15,19H,1-6,8-11H2

InChI key: InChIKey=AUEZNTKYSSUTGZ-UHFFFAOYSA-N

SMILES: OC1=C(C=CC=C1C2CCCCC2)C3CCCCC3

Synonyms:

• Phenol, 2,6-dicyclohexyl-
• 2,6-Dicyclohexylphenol