CymitQuimica logo

CAS 4821-89-0

:

7,8-Dimethoxy-1(2H)-phthalazinone

Description:
7,8-Dimethoxy-1(2H)-phthalazinone is an organic compound characterized by its phthalazinone core, which features a bicyclic structure containing a diazine ring fused to a carbonyl group. This compound is distinguished by the presence of two methoxy groups (-OCH3) located at the 7 and 8 positions of the phthalazinone ring, which can influence its chemical reactivity and solubility. Typically, compounds of this nature exhibit moderate to high polarity due to the methoxy substituents, which can enhance their solubility in polar solvents. The presence of the carbonyl group also suggests potential for hydrogen bonding and reactivity in various chemical reactions, such as nucleophilic attacks. Additionally, 7,8-Dimethoxy-1(2H)-phthalazinone may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, boiling point, and spectral characteristics, would be determined through experimental methods and can vary based on purity and environmental conditions.
Formula:C10H10N2O3
InChI:InChI=1S/C10H10N2O3/c1-14-7-4-3-6-5-11-12-10(13)8(6)9(7)15-2/h3-5H,1-2H3,(H,12,13)
InChI key:InChIKey=RMKSXDYWMIAVBW-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC=C1OC)C=NNC2=O
Synonyms:
  • 1(2H)-Phthalazinone, 7,8-dimethoxy-
  • 7,8-Dimethoxy-1(2H)-phthalazinone
  • Opiazone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.