CAS 482308-06-5
:3-methoxy-4-(morpholin-4-yl)aniline
Description:
3-Methoxy-4-(morpholin-4-yl)aniline is an organic compound characterized by its aniline structure, which features an amino group (-NH2) attached to a benzene ring. The presence of a methoxy group (-OCH3) at the 3-position and a morpholine ring at the 4-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the morpholine moiety, which enhances its hydrogen bonding capabilities. It may exhibit moderate to high stability under standard conditions but can be sensitive to strong acids or bases. The morpholine group can impart basic characteristics, making the compound potentially useful in various chemical reactions, including as a building block in pharmaceutical synthesis. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H16N2O2
InChI:InChI=1/C11H16N2O2/c1-14-11-8-9(12)2-3-10(11)13-4-6-15-7-5-13/h2-3,8H,4-7,12H2,1H3
SMILES:COc1cc(ccc1N1CCOCC1)N
Synonyms:- Benzenamine, 3-Methoxy-4-(4-Morpholinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
