CAS 482308-11-2
:5-amino-2-(3-oxomorpholin-4-yl)benzonitrile
Description:
5-Amino-2-(3-oxomorpholin-4-yl)benzonitrile, with the CAS number 482308-11-2, is a chemical compound that features a benzonitrile core substituted with an amino group and a morpholinone moiety. This compound is characterized by its aromatic structure, which contributes to its stability and potential reactivity. The presence of the amino group indicates that it can participate in hydrogen bonding and may act as a nucleophile in various chemical reactions. The morpholinone ring adds to its complexity, potentially influencing its solubility and interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its unique structure suggests potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. However, detailed studies on its physical properties, such as solubility, melting point, and reactivity, would be necessary to fully understand its behavior in different environments.
Formula:C11H11N3O2
InChI:InChI=1/C11H11N3O2/c12-6-8-5-9(13)1-2-10(8)14-3-4-16-7-11(14)15/h1-2,5H,3-4,7,13H2
Synonyms:- 5-Amino-2-(3-oxomorpholin-4-yl)benzonitril
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-Amino-2-(3-oxo-4-morpholinyl)benzonitrile
CAS:<p>5-Amino-2-(3-oxo-4-morpholinyl)benzonitrile (5ABA) is a potent, selective, and noncompetitive inhibitor of the ion channel TASK1. 5ABA inhibits the activation of TASK1 by interacting with the binding site for the activator protein, calcitonin gene-related peptide (CGRP). It has been shown that 5ABA inhibits CGRP-induced currents in rat sensory neurons in a dose dependent manner. This activity is specific to TASK1 channels, as it does not inhibit other members of the K+ channel superfamily.</p>Formula:C11H11N3O2Purity:Min. 95%Molecular weight:217.22 g/mol
