CAS 483-53-4
:3,4,5-trihydroxy-6-methylbenzene-1,2-dicarbaldehyde
Description:
3,4,5-Trihydroxy-6-methylbenzene-1,2-dicarbaldehyde, also known as 6-methyl-1,2-benzenedicarboxaldehyde, is an organic compound characterized by its aromatic structure featuring multiple hydroxyl groups and aldehyde functionalities. This compound contains a benzene ring substituted with three hydroxyl (-OH) groups at the 3, 4, and 5 positions, and two aldehyde (-CHO) groups at the 1 and 2 positions. The presence of these functional groups contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and oxidation. The hydroxyl groups enhance its solubility in polar solvents and can participate in hydrogen bonding, while the aldehyde groups can undergo further reactions typical of carbonyl compounds. This compound may exhibit biological activity, and its derivatives could be of interest in pharmaceuticals or materials science. Its CAS number, 483-53-4, allows for easy identification in chemical databases, facilitating research and application in various fields.
Formula:C9H8O5
InChI:InChI=1/C9H8O5/c1-4-5(2-10)6(3-11)8(13)9(14)7(4)12/h2-3,12-14H,1H3
SMILES:Cc1c(C=O)c(C=O)c(c(c1O)O)O
Synonyms:- 1,2-Benzenedicarboxaldehyde, 3,4,5-trihydroxy-6-methyl-
- 3,4,5-Trihydroxy-6-methyl-1,2-benzenedicarboxaldehyde
- Phthalaldehyde, 3,4,5-trihydroxy-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
