CAS 483-54-5

2,3-dimethoxy-5,6-dimethylcyclohexa-2,5-diene-1,4-dione

Description:

2,3-Dimethoxy-5,6-dimethylcyclohexa-2,5-diene-1,4-dione, with CAS number 483-54-5, is an organic compound characterized by its unique bicyclic structure featuring two methoxy groups and two methyl groups attached to a cyclohexadiene framework. This compound exhibits a conjugated diene system, which contributes to its potential reactivity and stability under various conditions. The presence of the diketone functional groups (1,4-dione) indicates that it can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. The methoxy groups enhance its solubility in organic solvents and may influence its electronic properties, making it a candidate for applications in organic synthesis and materials science. Additionally, the compound's structural features suggest potential biological activity, although specific biological properties would require further investigation. Overall, 2,3-dimethoxy-5,6-dimethylcyclohexa-2,5-diene-1,4-dione is a versatile compound with interesting chemical characteristics that warrant further exploration in both synthetic and applied chemistry contexts.

Formula: C₁₀H₁₂O₄

InChI: InChI=1/C10H12O4/c1-5-6(2)8(12)10(14-4)9(13-3)7(5)11/h1-4H3

SMILES: CC1=C(C)C(=O)C(=C(C1=O)OC)OC

Synonyms:

• 2,3-Dimethoxy-5,6-dimethyl-1,4-benzoquinone
• 2,3-Dimethoxy-5,6-dimethyl-2,5-cyclohexadiene-1,4-dione
• 2,5-Cyclohexadiene-1,4-Dione, 2,3-Dimethoxy-5,6-Dimethyl-
• Aurantiogliocladin
• 2,3-DIMETHOXY-5,6-DIMETHYL-P-BENZOQUINONE

2,3-Dimethoxy-5,6-dimethyl-p-benzoquinone

CAS: 483-54-5

2,3-Dimethoxy-5,6-dimethyl-p-benzoquinone is an organic compound commonly known as a quinone derivative, often categorized under synthetic quinones. This compound is typically synthesized in the laboratory, derived from the structural modification of naturally occurring benzoquinones, which are found in various biological systems. Its mode of action primarily involves redox cycling due to its electron transfer capabilities, allowing it to participate in electron transport chains and redox reactions.

Formula: C₁₀H₁₂O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 196.2 g/mol

Ref: 3D-FD66110

2,3-Dimethoxy-5,6-dimethyl-p-benzoquinone

Controlled Product

CAS: 483-54-5

Formula: C₁₀H₁₂O₄

Color and Shape: Neat

Molecular weight: 196.2

Ref: TR-D477275

Aurantiogliocladin

CAS: 483-54-5

Aurantiogliocladin is a mild antibiotic effective against Staphylococcus epidermidis, but it shows no efficacy against Staphylococcus aureus. It is also capable of inhibiting biofilm formation.

Formula: C₁₀H₁₂O₄

Color and Shape: Solid

Molecular weight: 196.2

Ref: TM-T205645