CAS 483-57-8
:6,8-Dimethylpyrimido[5,4-e]-1,2,4-triazine-5,7(6H,8H)-dione
Description:
6,8-Dimethylpyrimido[5,4-e]-1,2,4-triazine-5,7(6H,8H)-dione, with CAS number 483-57-8, is a heterocyclic compound characterized by its complex ring structure that incorporates both pyrimidine and triazine moieties. This compound features two methyl groups at the 6 and 8 positions, contributing to its unique chemical properties. It is known for its potential biological activity, particularly in the field of pharmaceuticals, where it may exhibit antimicrobial or antitumor properties. The presence of the dione functional groups indicates that it can participate in various chemical reactions, including hydrogen bonding and coordination with metal ions. Its solubility and stability can vary depending on the solvent and environmental conditions, making it important to consider these factors in practical applications. Overall, 6,8-Dimethylpyrimido[5,4-e]-1,2,4-triazine-5,7(6H,8H)-dione is a compound of interest in both synthetic and medicinal chemistry due to its structural features and potential reactivity.
Formula:C7H7N5O2
InChI:InChI=1S/C7H7N5O2/c1-11-5-4(8-3-9-10-5)6(13)12(2)7(11)14/h3H,1-2H3
InChI key:InChIKey=RRTKVYSLIGQWCO-UHFFFAOYSA-N
SMILES:O=C1C=2C(N(C)C(=O)N1C)=NN=CN2
Synonyms:- 1,3-Dimethylazalumazine
- 6,8-Dimethyl-5,7-dioxo-5,6,7,8-tetrahydropyrimido[5,4-e]-as-triazine
- Fervenulin
- Fervenuline
- NSC 68158
- Planomycin
- Pyrimido(5,4-e)-1,2,4-triazine-5,7(6H,8H)-dione, 6,8-dimethyl-
- Pyrimido[5,4-e]-as-triazine-5,7(6H,8H)-dione, 6,8-dimethyl-
- U 7118
- 6,8-Dimethylpyrimido[5,4-e]-1,2,4-triazine-5,7(6H,8H)-dione
- 6,8-Dimethylpyrimido[5,4-e]-1,2,4-triazine-5,7-(6H,8H)-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Fervenulin
CAS:Fervenulin, from Streptomyces sp. CMU-MH021, halts egg hatch (MIC: 30 μg/mL) and kills J2 larvae (MIC: 120 μg/mL) of M. incognita.Formula:C7H7N5O2Purity:99.75%Color and Shape:SolidMolecular weight:193.16Ref: TM-T15277
1mg71.00€5mg136.00€10mg210.00€25mg358.00€50mg500.00€100mg665.00€200mg893.00€1mL*10mM (DMSO)111.00€Fervenulin
CAS:Fervenulin is a synthetic compound, which is a chemically designed product developed for laboratory use. It is synthesized through a series of organic reactions, allowing for precise control over its molecular structure and properties. The mode of action for Fervenulin involves altering microbial growth pathways, particularly targeting specific enzymes and cellular processes critical for microbial proliferation. This mode of action effectively inhibits or modifies the activity of these cellular components, providing a tool for microbiologists to investigate microbial behavior under controlled conditions.
Formula:C7H7N5O2Purity:Min. 95%Molecular weight:193.16 g/molRef: 3D-AAA48357
Discontinued product


