CAS 483-78-3
:Cadalene
Description:
Cadalene, with the CAS number 483-78-3, is a bicyclic organic compound that belongs to the class of polycyclic aromatic hydrocarbons (PAHs). It is characterized by its unique structure, which consists of fused cyclopentane and cyclohexene rings. Cadalene is typically found in the form of a colorless to pale yellow liquid and has a distinctive aromatic odor. It is insoluble in water but soluble in organic solvents, which is a common trait among PAHs. Cadalene is primarily of interest in the fields of organic chemistry and materials science due to its potential applications in the synthesis of various chemical compounds and as a precursor in the production of specialty chemicals. Additionally, like many PAHs, cadalene may exhibit environmental persistence and potential toxicity, necessitating careful handling and assessment of its environmental impact. Its properties make it a subject of study in both industrial applications and environmental chemistry.
Formula:C15H18
InChI:InChI=1S/C15H18/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h5-10H,1-4H3
InChI key:InChIKey=VMOJIHDTVZTGDO-UHFFFAOYSA-N
SMILES:C(C)(C)C=1C2=C(C(C)=CC1)C=CC(C)=C2
Synonyms:- 1,6-Dimethyl-4-(1-methylethyl)naphthalene
- 1,6-Dimethyl-4-isopropylnaphthalene
- 4-Isopropyl-1,6-dimethylnaphthalene
- 483-78-3
- Cadalene
- Cadalin
- Naphthalene, 1,6-dimethyl-4-(1-methylethyl)-
- Naphthalene, 4-isopropyl-1,6-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
