CAS 483-85-2

2-Formyl-3,4-dimethoxybenzoic acid

Description:

2-Formyl-3,4-dimethoxybenzoic acid, with the CAS number 483-85-2, is an organic compound characterized by its aromatic structure featuring a formyl group (-CHO) and two methoxy groups (-OCH3) attached to a benzoic acid framework. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its aromatic nature. The presence of the carboxylic acid group (-COOH) contributes to its acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The methoxy groups enhance the compound's electron-donating ability, influencing its reactivity and stability. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in organic synthesis and as a building block for more complex molecules. Overall, 2-Formyl-3,4-dimethoxybenzoic acid is a versatile compound with significant implications in both research and industrial applications.

Formula: C₁₀H₁₀O₅

InChI: InChI=1S/C10H10O5/c1-14-8-4-3-6(10(12)13)7(5-11)9(8)15-2/h3-5H,1-2H3,(H,12,13)

InChI key: InChIKey=KMPIRHZKOQIJDD-UHFFFAOYSA-N

SMILES: C(=O)C1=C(OC)C(OC)=CC=C1C(O)=O

Synonyms:

• Phthalaldehydic acid, 3,4-dimethoxy-
• 2-Formyl-3,4-dimethoxybenzoic acid
• Benzoic acid, 2-formyl-3,4-dimethoxy-
• Pseudoopianic acid
• 3,4-Dimethoxy-o-phthalaldehydic acid