CAS 483-87-4
:1,7-dimethylphenanthrene
Description:
1,7-Dimethylphenanthrene is a polycyclic aromatic hydrocarbon (PAH) characterized by its structure, which consists of a phenanthrene backbone with two methyl groups attached at the 1 and 7 positions. This compound is typically a solid at room temperature and exhibits a high melting point due to its stable aromatic structure. It is insoluble in water but soluble in organic solvents, which is a common trait among PAHs. 1,7-Dimethylphenanthrene is known for its potential environmental persistence and can be found in fossil fuels and as a byproduct of combustion processes. Its presence in the environment raises concerns due to its potential carcinogenic properties, as many PAHs are associated with adverse health effects. The compound can be analyzed using various techniques, including gas chromatography and mass spectrometry, to assess its concentration in environmental samples. Overall, 1,7-dimethylphenanthrene serves as an important compound in studies related to organic chemistry, environmental science, and toxicology.
Formula:C16H14
InChI:InChI=1/C16H14/c1-11-6-8-15-13(10-11)7-9-14-12(2)4-3-5-16(14)15/h3-10H,1-2H3
SMILES:Cc1ccc2c(ccc3c(C)cccc23)c1
Synonyms:- Phenanthrene, 1,7-Dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1,7-Dimethyl-phenanthrene
CAS:Applications 1,7-Dimethyl-phenanthrene is an environmental pollutant.
References Benner, B., et al.: Environ. Sci. Technol., 29, 2382 (1995);Formula:C16H14Color and Shape:NeatMolecular weight:206.28

