CAS 4833-92-5
:5-Sulfo-3-pyridinecarboxylic acid
Description:
5-Sulfo-3-pyridinecarboxylic acid, also known as pyridine-3-carboxylic acid-5-sulfonic acid, is an aromatic sulfonic acid derivative of pyridine. It features a pyridine ring with a carboxylic acid group and a sulfonic acid group, which contribute to its acidic properties and solubility in water. This compound is typically a white to off-white solid and is highly soluble in polar solvents due to the presence of the sulfonic acid group. It exhibits strong acidity, which can influence its reactivity and interactions in various chemical environments. The sulfonic acid group enhances its ability to act as a ligand in coordination chemistry and can also facilitate its use in biological applications, such as in the synthesis of pharmaceuticals or as a reagent in organic synthesis. Additionally, its structural characteristics allow it to participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a versatile compound in both research and industrial applications.
Formula:C6H5NO5S
InChI:InChI=1S/C6H5NO5S/c8-6(9)4-1-5(3-7-2-4)13(10,11)12/h1-3H,(H,8,9)(H,10,11,12)
InChI key:InChIKey=NIPHSJOBXPXRPU-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C=1C=C(C(O)=O)C=NC1
Synonyms:- 3-Pyridinecarboxylic Acid, 5-Sulfo-
- 5-Sulfo-3-pyridinecarboxylic acid
- 5-Sulfonicotinic Acid
- Nicotinic acid, 5-sulfo-
- 5-Sulfopyridine-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
