CymitQuimica logo

CAS 483324-01-2

:

4-(3-Pyridyl)-2-chloropyrimidine

Description:
4-(3-Pyridyl)-2-chloropyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is substituted with a chlorine atom and a pyridine moiety. The presence of the chlorine atom at the 2-position of the pyrimidine ring contributes to its reactivity and potential applications in medicinal chemistry. The 3-pyridyl group enhances the compound's ability to interact with biological targets, making it of interest in drug discovery and development. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water, which is common for many heterocyclic compounds. Its molecular structure allows for various chemical modifications, potentially leading to derivatives with enhanced biological activity. Additionally, 4-(3-Pyridyl)-2-chloropyrimidine may exhibit specific spectral properties, such as UV-Vis and NMR characteristics, that can be utilized for analytical identification and characterization. Overall, this compound's unique structural features make it a valuable candidate for further research in pharmacology and organic synthesis.
Formula:C9H6ClN3
InChI:InChI=1/C9H6ClN3/c10-9-12-5-3-8(13-9)7-2-1-4-11-6-7/h1-6H
InChI key:MGQROXOMFRGAOY-UHFFFAOYSA-N
SMILES:c1cc(cnc1)c1ccnc(Cl)n1
Synonyms:
  • 2-Chloro-4-(3-pyridyl)pyrimidine
  • 2-Chloro-4-(pyridin-3-yl)pyrimidine
  • 2-Chloro-4-Pyridin-3-Ylpyrimidine
  • 2-Chloro-4-(3-pyridinyl)pyrimidine
Found 4 products.