CAS 4836-69-5

2-(2,4-dinitrophenyl)ethanol

Description:

2-(2,4-Dinitrophenyl)ethanol, with the CAS number 4836-69-5, is an organic compound characterized by its dinitrophenyl group attached to an ethanol moiety. This compound typically appears as a yellow crystalline solid due to the presence of the dinitro substituents, which are known for their strong electron-withdrawing properties. It is soluble in organic solvents but has limited solubility in water. The presence of the hydroxyl (-OH) group contributes to its reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and esterifications. Additionally, the dinitrophenyl group can enhance the compound's ability to form complexes with metals and other nucleophiles. Due to its structure, 2-(2,4-dinitrophenyl)ethanol can also exhibit significant biological activity, making it of interest in both synthetic organic chemistry and pharmacological research. However, caution is advised when handling this compound, as dinitrophenyl derivatives can be toxic and potentially hazardous.

Formula: C₈H₈N₂O₅

InChI: InChI=1/C8H8N2O5/c11-4-3-6-1-2-7(9(12)13)5-8(6)10(14)15/h1-2,5,11H,3-4H2

SMILES: c1cc(cc(c1CCO)N(=O)=O)N(=O)=O

Synonyms:

• Benzeneethanol, 2,4-Dinitro-
• 2,4-Dinitrobenzene-ethanol
• 2-(2,4-DINITROPHENYL)ETHANOL
• 2,4-Dinitrophenethyl alcohol
• 2,4-Dinitro phenyl ethyl alcohol

Benzeneethanol,2,4-dinitro-

CAS: 4836-69-5

Formula: C₈H₈N₂O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 212.1595

Ref: IN-DA006WU9

2,4-Dinitrophenylethylalcohol

CAS: 4836-69-5

2,4-Dinitrophenylethylalcohol

Purity: 95%

Molecular weight: 212.16g/mol

Ref: 54-OR1073518

2-(2,4-DINITROPHENYL)ETHANOL

CAS: 4836-69-5

Formula: C₈H₈N₂O₅

Purity: 95%

Molecular weight: 212.161

Ref: 10-F303016