CAS 4837-19-8

3-(difluoromethoxy)benzoic acid

Description:

3-(Difluoromethoxy)benzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid moiety substituted with a difluoromethoxy group at the meta position. This compound features a benzene ring, which contributes to its stability and reactivity, along with a carboxylic acid functional group (-COOH) that imparts acidic properties. The difluoromethoxy group (-O-CHF2) enhances the compound's polarity and can influence its solubility in various solvents. The presence of fluorine atoms typically increases the compound's lipophilicity and can affect its biological activity. 3-(Difluoromethoxy)benzoic acid may be utilized in various chemical syntheses and research applications, particularly in the development of pharmaceuticals or agrochemicals. Its unique structural features may also contribute to specific interactions in biological systems, making it of interest in medicinal chemistry. As with many fluorinated compounds, it is essential to handle this substance with care due to potential environmental and health impacts associated with fluorinated chemicals.

Formula: C₈H₅F₂O₃

InChI: InChI=1/C8H6F2O3/c9-8(10)13-6-3-1-2-5(4-6)7(11)12/h1-4,8H,(H,11,12)/p-1

SMILES: c1cc(cc(c1)OC(F)F)C(=O)[O-]

Synonyms:

• 3-(Difluoromethoxy)Benzoate

3-(Difluoromethoxy)benzoic acid

CAS: 4837-19-8

Formula: C₈H₆F₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.1282

Ref: IN-DA003BAB

3-(Difluoromethoxy)benzoic acid

CAS: 4837-19-8

3-(Difluoromethoxy)benzoic acid

Formula: C₈H₆F₂O₃

Purity: 98%

Color and Shape: White Powder

Molecular weight: 188.13g/mol

Ref: 54-PC9131

3-(Difluoromethoxy)benzoic acid

CAS: 4837-19-8

Formula: C₈H₆F₂O₃

Purity: 97%

Color and Shape: Solid, Off-white powder

Molecular weight: 188.13

Ref: 10-F007853